C17H29N3O3 — CID 70779114
[2-(2-ethoxyethyl)-5-methylpyrazol-3-yl]-[(4S)-4-hydroxy-3,3,4-trimethylpiperidin-1-yl]methanone (PubChem CID 70779114) has the molecular formula C17H29N3O3 and a molecular weight of 323.44 g/mol. Its IUPAC name is [2-(2-ethoxyethyl)-5-methylpyrazol-3-yl]-[(4S)-4-hydroxy-3,3,4-trimethylpiperidin-1-yl]methanone.
| Compound Name | [2-(2-ethoxyethyl)-5-methylpyrazol-3-yl]-[(4S)-4-hydroxy-3,3,4-trimethylpiperidin-1-yl]methanone |
|---|---|
| PubChem CID | 70779114 |
| Molecular Formula | C17H29N3O3 |
| Molecular Weight | 323.44 g/mol |
| Exact Mass | 323.22 |
| IUPAC Name | [2-(2-ethoxyethyl)-5-methylpyrazol-3-yl]-[(4S)-4-hydroxy-3,3,4-trimethylpiperidin-1-yl]methanone |
| SMILES | CCOCCn1nc(C)cc1C(=O)N1CC[C@](C)(O)C(C)(C)C1 |
| InChI | InChI=1S/C17H29N3O3/c1-6-23-10-9-20-14(11-13(2)18-20)15(21)19-8-7-17(5,22)16(3,4)12-19/h11,22H,6-10,12H2,1-5H3/t17-/m0/s1 |
| InChIKey | FFVPVMJBANKBES-KRWDZBQOSA-N |
| XLogP | 1.85 |
| TPSA | 67.59 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.44 |
| LogP ≤ 5 | 1.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|