C18H31N5O2S — CID 70779256
5-[[(4aR,7aS)-6,6-dioxo-1-pentyl-2,3,4a,5,7,7a-hexahydrothieno[3,4-b]pyrazin-4-yl]methyl]-N-ethylpyrimidin-2-amine (PubChem CID 70779256) has the molecular formula C18H31N5O2S and a molecular weight of 381.55 g/mol. Its IUPAC name is 5-[[(4aR,7aS)-6,6-dioxo-1-pentyl-2,3,4a,5,7,7a-hexahydrothieno[3,4-b]pyrazin-4-yl]methyl]-N-ethylpyrimidin-2-amine.
| Compound Name | 5-[[(4aR,7aS)-6,6-dioxo-1-pentyl-2,3,4a,5,7,7a-hexahydrothieno[3,4-b]pyrazin-4-yl]methyl]-N-ethylpyrimidin-2-amine |
|---|---|
| PubChem CID | 70779256 |
| Molecular Formula | C18H31N5O2S |
| Molecular Weight | 381.55 g/mol |
| Exact Mass | 381.22 |
| IUPAC Name | 5-[[(4aR,7aS)-6,6-dioxo-1-pentyl-2,3,4a,5,7,7a-hexahydrothieno[3,4-b]pyrazin-4-yl]methyl]-N-ethylpyrimidin-2-amine |
| SMILES | CCCCCN1CCN(Cc2cnc(NCC)nc2)[C@H]2CS(=O)(=O)C[C@H]21 |
| InChI | InChI=1S/C18H31N5O2S/c1-3-5-6-7-22-8-9-23(17-14-26(24,25)13-16(17)22)12-15-10-20-18(19-4-2)21-11-15/h10-11,16-17H,3-9,12-14H2,1-2H3,(H,19,20,21)/t16-,17+/m1/s1 |
| InChIKey | JTLSIASIPKPBLN-SJORKVTESA-N |
| XLogP | 1.38 |
| TPSA | 78.43 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.55 |
| LogP ≤ 5 | 1.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|