C19H25ClN4O — CID 70779708
4-[[4-[4-(2-chlorophenyl)piperidin-4-yl]pyrimidin-2-yl]amino]butan-1-ol (PubChem CID 70779708) has the molecular formula C19H25ClN4O and a molecular weight of 360.89 g/mol. Its IUPAC name is 4-[[4-[4-(2-chlorophenyl)piperidin-4-yl]pyrimidin-2-yl]amino]butan-1-ol.
| Compound Name | 4-[[4-[4-(2-chlorophenyl)piperidin-4-yl]pyrimidin-2-yl]amino]butan-1-ol |
|---|---|
| PubChem CID | 70779708 |
| Molecular Formula | C19H25ClN4O |
| Molecular Weight | 360.89 g/mol |
| Exact Mass | 360.17 |
| IUPAC Name | 4-[[4-[4-(2-chlorophenyl)piperidin-4-yl]pyrimidin-2-yl]amino]butan-1-ol |
| SMILES | OCCCCNc1nccc(C2(c3ccccc3Cl)CCNCC2)n1 |
| InChI | InChI=1S/C19H25ClN4O/c20-16-6-2-1-5-15(16)19(8-12-21-13-9-19)17-7-11-23-18(24-17)22-10-3-4-14-25/h1-2,5-7,11,21,25H,3-4,8-10,12-14H2,(H,22,23,24) |
| InChIKey | MHKQEZXWEBKLQE-UHFFFAOYSA-N |
| XLogP | 2.98 |
| TPSA | 70.07 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.89 |
| LogP ≤ 5 | 2.98 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|