About Acetoacet-o-anisidide
Acetoacet-o-anisidide (PubChem CID 7078) has the molecular formula C11H13NO3
and a molecular weight of 207.23 g/mol. Its IUPAC name is N-(2-methoxyphenyl)-3-oxobutanamide.
Molecular Properties
| Compound Name | Acetoacet-o-anisidide |
| PubChem CID | 7078 |
| Molecular Formula | C11H13NO3 |
| Molecular Weight | 207.23 g/mol |
| Exact Mass | 207.09 |
| IUPAC Name | N-(2-methoxyphenyl)-3-oxobutanamide |
| SMILES | CC(=O)CC(=O)NC1=CC=CC=C1OC |
| InChI | InChI=1S/C11H13NO3/c1-8(13)7-11(14)12-9-5-3-4-6-10(9)15-2/h3-6H,7H2,1-2H3,(H,12,14) |
| InChIKey | KYYRTDXOHQYZPO-UHFFFAOYSA-N |
| XLogP | 1.50 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | 240 |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 207.23 |
| LogP ≤ 5 | 1.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|
Analyze Acetoacet-o-anisidide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of Acetoacet-o-anisidide?
The IUPAC name of Acetoacet-o-anisidide (CID 7078) is N-(2-methoxyphenyl)-3-oxobutanamide.
What is the SMILES notation for Acetoacet-o-anisidide?
The canonical SMILES for Acetoacet-o-anisidide is CC(=O)CC(=O)NC1=CC=CC=C1OC.
What is the InChIKey of Acetoacet-o-anisidide?
The InChIKey is KYYRTDXOHQYZPO-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H13NO3/c1-8(13)7-11(14)12-9-5-3-4-6-10(9)15-2/h3-6H,7H2,1-2H3,(H,12,14).
What are the key properties of Acetoacet-o-anisidide?
Acetoacet-o-anisidide has a molecular weight of 207.23 g/mol, XLogP of 1.50, 4 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for Acetoacet-o-anisidide is sourced from PubChem (CID 7078), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).