C20H20ClN3O2 — CID 70780279
2-[3-[(8-chloro-1,3,4,5-tetrahydropyrido[4,3-b]indol-2-yl)methyl]phenoxy]acetamide (PubChem CID 70780279) has the molecular formula C20H20ClN3O2 and a molecular weight of 369.85 g/mol. Its IUPAC name is 2-[3-[(8-chloro-1,3,4,5-tetrahydropyrido[4,3-b]indol-2-yl)methyl]phenoxy]acetamide.
| Compound Name | 2-[3-[(8-chloro-1,3,4,5-tetrahydropyrido[4,3-b]indol-2-yl)methyl]phenoxy]acetamide |
|---|---|
| PubChem CID | 70780279 |
| Molecular Formula | C20H20ClN3O2 |
| Molecular Weight | 369.85 g/mol |
| Exact Mass | 369.12 |
| IUPAC Name | 2-[3-[(8-chloro-1,3,4,5-tetrahydropyrido[4,3-b]indol-2-yl)methyl]phenoxy]acetamide |
| SMILES | NC(=O)COc1cccc(CN2CCc3[nH]c4ccc(Cl)cc4c3C2)c1 |
| InChI | InChI=1S/C20H20ClN3O2/c21-14-4-5-18-16(9-14)17-11-24(7-6-19(17)23-18)10-13-2-1-3-15(8-13)26-12-20(22)25/h1-5,8-9,23H,6-7,10-12H2,(H2,22,25) |
| InChIKey | WSCCTYTYHYLUAZ-UHFFFAOYSA-N |
| XLogP | 3.24 |
| TPSA | 71.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.85 |
| LogP ≤ 5 | 3.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|