C16H26N4O2S — CID 70780793
(4aR,7aS)-1-(3-methylbut-2-enyl)-4-[(1-methylimidazol-2-yl)methyl]-2,3,4a,5,7,7a-hexahydrothieno[3,4-b]pyrazine 6,6-dioxide (PubChem CID 70780793) has the molecular formula C16H26N4O2S and a molecular weight of 338.48 g/mol. Its IUPAC name is (4aR,7aS)-1-(3-methylbut-2-enyl)-4-[(1-methylimidazol-2-yl)methyl]-2,3,4a,5,7,7a-hexahydrothieno[3,4-b]pyrazine 6,6-dioxide.
| Compound Name | (4aR,7aS)-1-(3-methylbut-2-enyl)-4-[(1-methylimidazol-2-yl)methyl]-2,3,4a,5,7,7a-hexahydrothieno[3,4-b]pyrazine 6,6-dioxide |
|---|---|
| PubChem CID | 70780793 |
| Molecular Formula | C16H26N4O2S |
| Molecular Weight | 338.48 g/mol |
| Exact Mass | 338.18 |
| IUPAC Name | (4aR,7aS)-1-(3-methylbut-2-enyl)-4-[(1-methylimidazol-2-yl)methyl]-2,3,4a,5,7,7a-hexahydrothieno[3,4-b]pyrazine 6,6-dioxide |
| SMILES | CC(C)=CCN1CCN(Cc2nccn2C)[C@H]2CS(=O)(=O)C[C@H]21 |
| InChI | InChI=1S/C16H26N4O2S/c1-13(2)4-6-19-8-9-20(10-16-17-5-7-18(16)3)15-12-23(21,22)11-14(15)19/h4-5,7,14-15H,6,8-12H2,1-3H3/t14-,15+/m1/s1 |
| InChIKey | DWGIFAAUUYMEAN-CABCVRRESA-N |
| XLogP | 0.67 |
| TPSA | 58.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.48 |
| LogP ≤ 5 | 0.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|