C16H20NO3+ — CID 7078085
(1S,11S,12S,15S,16R)-16-hydroxy-12-methyl-13-oxa-10-azoniatetracyclo[8.7.0.02,7.011,15]heptadeca-2,4,6-trien-14-one (PubChem CID 7078085) has the molecular formula C16H20NO3+ and a molecular weight of 274.34 g/mol. Its IUPAC name is (1S,11S,12S,15S,16R)-16-hydroxy-12-methyl-13-oxa-10-azoniatetracyclo[8.7.0.02,7.011,15]heptadeca-2,4,6-trien-14-one.
| Compound Name | (1S,11S,12S,15S,16R)-16-hydroxy-12-methyl-13-oxa-10-azoniatetracyclo[8.7.0.02,7.011,15]heptadeca-2,4,6-trien-14-one |
|---|---|
| PubChem CID | 7078085 |
| Molecular Formula | C16H20NO3+ |
| Molecular Weight | 274.34 g/mol |
| Exact Mass | 274.14 |
| IUPAC Name | (1S,11S,12S,15S,16R)-16-hydroxy-12-methyl-13-oxa-10-azoniatetracyclo[8.7.0.02,7.011,15]heptadeca-2,4,6-trien-14-one |
| SMILES | C[C@@H]1OC(=O)[C@H]2[C@@H]1[NH+]1CCc3ccccc3[C@@H]1C[C@H]2O |
| InChI | InChI=1S/C16H19NO3/c1-9-15-14(16(19)20-9)13(18)8-12-11-5-3-2-4-10(11)6-7-17(12)15/h2-5,9,12-15,18H,6-8H2,1H3/p+1/t9-,12-,13+,14+,15+/m0/s1 |
| InChIKey | MPEJFJFZVUSBET-NJEAUENSSA-O |
| XLogP | -0.14 |
| TPSA | 50.97 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.34 |
| LogP ≤ 5 | -0.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |