C25H30N4 — CID 70781067
2-[[3-(3-methylphenyl)-1-(4-methylphenyl)pyrazol-4-yl]methyl]-3,4,6,7,8,8a-hexahydro-1H-pyrrolo[1,2-a]pyrazine (PubChem CID 70781067) has the molecular formula C25H30N4 and a molecular weight of 386.54 g/mol. Its IUPAC name is 2-[[3-(3-methylphenyl)-1-(4-methylphenyl)pyrazol-4-yl]methyl]-3,4,6,7,8,8a-hexahydro-1H-pyrrolo[1,2-a]pyrazine.
| Compound Name | 2-[[3-(3-methylphenyl)-1-(4-methylphenyl)pyrazol-4-yl]methyl]-3,4,6,7,8,8a-hexahydro-1H-pyrrolo[1,2-a]pyrazine |
|---|---|
| PubChem CID | 70781067 |
| Molecular Formula | C25H30N4 |
| Molecular Weight | 386.54 g/mol |
| Exact Mass | 386.25 |
| IUPAC Name | 2-[[3-(3-methylphenyl)-1-(4-methylphenyl)pyrazol-4-yl]methyl]-3,4,6,7,8,8a-hexahydro-1H-pyrrolo[1,2-a]pyrazine |
| SMILES | Cc1ccc(-n2cc(CN3CCN4CCCC4C3)c(-c3cccc(C)c3)n2)cc1 |
| InChI | InChI=1S/C25H30N4/c1-19-8-10-23(11-9-19)29-17-22(25(26-29)21-6-3-5-20(2)15-21)16-27-13-14-28-12-4-7-24(28)18-27/h3,5-6,8-11,15,17,24H,4,7,12-14,16,18H2,1-2H3 |
| InChIKey | YDWDHCHUQIVPJL-UHFFFAOYSA-N |
| XLogP | 4.44 |
| TPSA | 24.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.54 |
| LogP ≤ 5 | 4.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |