C20H31NO2 — CID 70781090
4-[4-[[(3aS,6aS)-3a-(hydroxymethyl)-1,3,4,5,6,6a-hexahydrocyclopenta[c]pyrrol-2-yl]methyl]phenyl]-2-methylbutan-2-ol (PubChem CID 70781090) has the molecular formula C20H31NO2 and a molecular weight of 317.47 g/mol. Its IUPAC name is 4-[4-[[(3aS,6aS)-3a-(hydroxymethyl)-1,3,4,5,6,6a-hexahydrocyclopenta[c]pyrrol-2-yl]methyl]phenyl]-2-methylbutan-2-ol.
| Compound Name | 4-[4-[[(3aS,6aS)-3a-(hydroxymethyl)-1,3,4,5,6,6a-hexahydrocyclopenta[c]pyrrol-2-yl]methyl]phenyl]-2-methylbutan-2-ol |
|---|---|
| PubChem CID | 70781090 |
| Molecular Formula | C20H31NO2 |
| Molecular Weight | 317.47 g/mol |
| Exact Mass | 317.24 |
| IUPAC Name | 4-[4-[[(3aS,6aS)-3a-(hydroxymethyl)-1,3,4,5,6,6a-hexahydrocyclopenta[c]pyrrol-2-yl]methyl]phenyl]-2-methylbutan-2-ol |
| SMILES | CC(C)(O)CCc1ccc(CN2C[C@H]3CCC[C@@]3(CO)C2)cc1 |
| InChI | InChI=1S/C20H31NO2/c1-19(2,23)11-9-16-5-7-17(8-6-16)12-21-13-18-4-3-10-20(18,14-21)15-22/h5-8,18,22-23H,3-4,9-15H2,1-2H3/t18-,20+/m1/s1 |
| InChIKey | GCXDROOSVYEYOM-QUCCMNQESA-N |
| XLogP | 2.98 |
| TPSA | 43.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.47 |
| LogP ≤ 5 | 2.98 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |