C16H22N2O5S — CID 70781485
1-[(4aR,7aS)-4-(furan-2-carbonyl)-6,6-dioxo-2,3,4a,5,7,7a-hexahydrothieno[3,4-b]pyrazin-1-yl]-3-methylbutan-1-one (PubChem CID 70781485) has the molecular formula C16H22N2O5S and a molecular weight of 354.43 g/mol. Its IUPAC name is 1-[(4aR,7aS)-4-(furan-2-carbonyl)-6,6-dioxo-2,3,4a,5,7,7a-hexahydrothieno[3,4-b]pyrazin-1-yl]-3-methylbutan-1-one.
| Compound Name | 1-[(4aR,7aS)-4-(furan-2-carbonyl)-6,6-dioxo-2,3,4a,5,7,7a-hexahydrothieno[3,4-b]pyrazin-1-yl]-3-methylbutan-1-one |
|---|---|
| PubChem CID | 70781485 |
| Molecular Formula | C16H22N2O5S |
| Molecular Weight | 354.43 g/mol |
| Exact Mass | 354.12 |
| IUPAC Name | 1-[(4aR,7aS)-4-(furan-2-carbonyl)-6,6-dioxo-2,3,4a,5,7,7a-hexahydrothieno[3,4-b]pyrazin-1-yl]-3-methylbutan-1-one |
| SMILES | CC(C)CC(=O)N1CCN(C(=O)c2ccco2)[C@H]2CS(=O)(=O)C[C@H]21 |
| InChI | InChI=1S/C16H22N2O5S/c1-11(2)8-15(19)17-5-6-18(16(20)14-4-3-7-23-14)13-10-24(21,22)9-12(13)17/h3-4,7,11-13H,5-6,8-10H2,1-2H3/t12-,13+/m1/s1 |
| InChIKey | GWAMQEDGERFTFC-OLZOCXBDSA-N |
| XLogP | 0.78 |
| TPSA | 87.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.43 |
| LogP ≤ 5 | 0.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |