C11H13ClO5 — CID 7078165
(2S,3R,4R,5R)-2-(2-chlorophenoxy)oxane-3,4,5-triol (PubChem CID 7078165) has the molecular formula C11H13ClO5 and a molecular weight of 260.67 g/mol. Its IUPAC name is (2S,3R,4R,5R)-2-(2-chlorophenoxy)oxane-3,4,5-triol.
| Compound Name | (2S,3R,4R,5R)-2-(2-chlorophenoxy)oxane-3,4,5-triol |
|---|---|
| PubChem CID | 7078165 |
| Molecular Formula | C11H13ClO5 |
| Molecular Weight | 260.67 g/mol |
| Exact Mass | 260.05 |
| IUPAC Name | (2S,3R,4R,5R)-2-(2-chlorophenoxy)oxane-3,4,5-triol |
| SMILES | O[C@H]1[C@H](Oc2ccccc2Cl)OC[C@@H](O)[C@H]1O |
| InChI | InChI=1S/C11H13ClO5/c12-6-3-1-2-4-8(6)17-11-10(15)9(14)7(13)5-16-11/h1-4,7,9-11,13-15H,5H2/t7-,9-,10-,11+/m1/s1 |
| InChIKey | BBLYSAOWWVWKNA-WKJUBOCMSA-N |
| XLogP | 0.16 |
| TPSA | 79.15 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 260.67 |
| LogP ≤ 5 | 0.16 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |