C25H24N2OS — CID 70781851
1-[(8-methyl-2-thiophen-2-ylquinolin-3-yl)methyl]-3-phenylpyrrolidin-3-ol (PubChem CID 70781851) has the molecular formula C25H24N2OS and a molecular weight of 400.55 g/mol. Its IUPAC name is 1-[(8-methyl-2-thiophen-2-ylquinolin-3-yl)methyl]-3-phenylpyrrolidin-3-ol.
| Compound Name | 1-[(8-methyl-2-thiophen-2-ylquinolin-3-yl)methyl]-3-phenylpyrrolidin-3-ol |
|---|---|
| PubChem CID | 70781851 |
| Molecular Formula | C25H24N2OS |
| Molecular Weight | 400.55 g/mol |
| Exact Mass | 400.16 |
| IUPAC Name | 1-[(8-methyl-2-thiophen-2-ylquinolin-3-yl)methyl]-3-phenylpyrrolidin-3-ol |
| SMILES | Cc1cccc2cc(CN3CCC(O)(c4ccccc4)C3)c(-c3cccs3)nc12 |
| InChI | InChI=1S/C25H24N2OS/c1-18-7-5-8-19-15-20(24(26-23(18)19)22-11-6-14-29-22)16-27-13-12-25(28,17-27)21-9-3-2-4-10-21/h2-11,14-15,28H,12-13,16-17H2,1H3 |
| InChIKey | UKKRTGBZHHNBIV-UHFFFAOYSA-N |
| XLogP | 5.37 |
| TPSA | 36.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.55 |
| LogP ≤ 5 | 5.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |