About N-methyl-N-[(4-phenyl-1,3-thiazol-2-yl)methyl]-1-propan-2-ylpyrazole-4-carboxamide
N-methyl-N-[(4-phenyl-1,3-thiazol-2-yl)methyl]-1-propan-2-ylpyrazole-4-carboxamide (PubChem CID 70782025) has the molecular formula C18H20N4OS
and a molecular weight of 340.45 g/mol. Its IUPAC name is N-methyl-N-[(4-phenyl-1,3-thiazol-2-yl)methyl]-1-propan-2-ylpyrazole-4-carboxamide.
Molecular Properties
| Compound Name | N-methyl-N-[(4-phenyl-1,3-thiazol-2-yl)methyl]-1-propan-2-ylpyrazole-4-carboxamide |
| PubChem CID | 70782025 |
| Molecular Formula | C18H20N4OS |
| Molecular Weight | 340.45 g/mol |
| Exact Mass | 340.14 |
| IUPAC Name | N-methyl-N-[(4-phenyl-1,3-thiazol-2-yl)methyl]-1-propan-2-ylpyrazole-4-carboxamide |
| SMILES | CC(C)n1cc(C(=O)N(C)Cc2nc(-c3ccccc3)cs2)cn1 |
| InChI | InChI=1S/C18H20N4OS/c1-13(2)22-10-15(9-19-22)18(23)21(3)11-17-20-16(12-24-17)14-7-5-4-6-8-14/h4-10,12-13H,11H2,1-3H3 |
| InChIKey | ZIXJRJZCEBRKON-UHFFFAOYSA-N |
| XLogP | 3.86 |
| TPSA | 51.02 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 340.45 |
| LogP ≤ 5 | 3.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze N-methyl-N-[(4-phenyl-1,3-thiazol-2-yl)methyl]-1-propan-2-ylpyrazole-4-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-methyl-N-[(4-phenyl-1,3-thiazol-2-yl)methyl]-1-propan-2-ylpyrazole-4-carboxamide?
The IUPAC name of N-methyl-N-[(4-phenyl-1,3-thiazol-2-yl)methyl]-1-propan-2-ylpyrazole-4-carboxamide (CID 70782025) is N-methyl-N-[(4-phenyl-1,3-thiazol-2-yl)methyl]-1-propan-2-ylpyrazole-4-carboxamide.
What is the SMILES notation for N-methyl-N-[(4-phenyl-1,3-thiazol-2-yl)methyl]-1-propan-2-ylpyrazole-4-carboxamide?
The canonical SMILES for N-methyl-N-[(4-phenyl-1,3-thiazol-2-yl)methyl]-1-propan-2-ylpyrazole-4-carboxamide is CC(C)n1cc(C(=O)N(C)Cc2nc(-c3ccccc3)cs2)cn1.
What is the InChIKey of N-methyl-N-[(4-phenyl-1,3-thiazol-2-yl)methyl]-1-propan-2-ylpyrazole-4-carboxamide?
The InChIKey is ZIXJRJZCEBRKON-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H20N4OS/c1-13(2)22-10-15(9-19-22)18(23)21(3)11-17-20-16(12-24-17)14-7-5-4-6-8-14/h4-10,12-13H,11H2,1-3H3.
What are the key properties of N-methyl-N-[(4-phenyl-1,3-thiazol-2-yl)methyl]-1-propan-2-ylpyrazole-4-carboxamide?
N-methyl-N-[(4-phenyl-1,3-thiazol-2-yl)methyl]-1-propan-2-ylpyrazole-4-carboxamide has a molecular weight of 340.45 g/mol, XLogP of 3.86, 5 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for N-methyl-N-[(4-phenyl-1,3-thiazol-2-yl)methyl]-1-propan-2-ylpyrazole-4-carboxamide is sourced from PubChem (CID 70782025), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).