C19H25N5O2 — CID 70782080
N-[1-[4-(3-methoxypropyl)-1,2,4-triazol-3-yl]ethyl]-3,5-dimethyl-1H-indole-2-carboxamide (PubChem CID 70782080) has the molecular formula C19H25N5O2 and a molecular weight of 355.44 g/mol. Its IUPAC name is N-[1-[4-(3-methoxypropyl)-1,2,4-triazol-3-yl]ethyl]-3,5-dimethyl-1H-indole-2-carboxamide.
| Compound Name | N-[1-[4-(3-methoxypropyl)-1,2,4-triazol-3-yl]ethyl]-3,5-dimethyl-1H-indole-2-carboxamide |
|---|---|
| PubChem CID | 70782080 |
| Molecular Formula | C19H25N5O2 |
| Molecular Weight | 355.44 g/mol |
| Exact Mass | 355.20 |
| IUPAC Name | N-[1-[4-(3-methoxypropyl)-1,2,4-triazol-3-yl]ethyl]-3,5-dimethyl-1H-indole-2-carboxamide |
| SMILES | COCCCn1cnnc1C(C)NC(=O)c1[nH]c2ccc(C)cc2c1C |
| InChI | InChI=1S/C19H25N5O2/c1-12-6-7-16-15(10-12)13(2)17(22-16)19(25)21-14(3)18-23-20-11-24(18)8-5-9-26-4/h6-7,10-11,14,22H,5,8-9H2,1-4H3,(H,21,25) |
| InChIKey | FZQBTWXTRWULKF-UHFFFAOYSA-N |
| XLogP | 2.90 |
| TPSA | 84.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.44 |
| LogP ≤ 5 | 2.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|