About 2-[1'-(2-methylfuran-3-carbonyl)-2-oxospiro[indole-3,3'-pyrrolidine]-1-yl]acetamide
2-[1'-(2-methylfuran-3-carbonyl)-2-oxospiro[indole-3,3'-pyrrolidine]-1-yl]acetamide (PubChem CID 70782211) has the molecular formula C19H19N3O4
and a molecular weight of 353.38 g/mol. Its IUPAC name is 2-[1'-(2-methylfuran-3-carbonyl)-2-oxospiro[indole-3,3'-pyrrolidine]-1-yl]acetamide.
Molecular Properties
| Compound Name | 2-[1'-(2-methylfuran-3-carbonyl)-2-oxospiro[indole-3,3'-pyrrolidine]-1-yl]acetamide |
| PubChem CID | 70782211 |
| Molecular Formula | C19H19N3O4 |
| Molecular Weight | 353.38 g/mol |
| Exact Mass | 353.14 |
| IUPAC Name | 2-[1'-(2-methylfuran-3-carbonyl)-2-oxospiro[indole-3,3'-pyrrolidine]-1-yl]acetamide |
| SMILES | Cc1occc1C(=O)N1CCC2(C1)C(=O)N(CC(N)=O)c1ccccc12 |
| InChI | InChI=1S/C19H19N3O4/c1-12-13(6-9-26-12)17(24)21-8-7-19(11-21)14-4-2-3-5-15(14)22(18(19)25)10-16(20)23/h2-6,9H,7-8,10-11H2,1H3,(H2,20,23) |
| InChIKey | SLLMBPZYUBOQDO-UHFFFAOYSA-N |
| XLogP | 1.20 |
| TPSA | 96.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 353.38 |
| LogP ≤ 5 | 1.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 2-[1'-(2-methylfuran-3-carbonyl)-2-oxospiro[indole-3,3'-pyrrolidine]-1-yl]acetamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[1'-(2-methylfuran-3-carbonyl)-2-oxospiro[indole-3,3'-pyrrolidine]-1-yl]acetamide?
The IUPAC name of 2-[1'-(2-methylfuran-3-carbonyl)-2-oxospiro[indole-3,3'-pyrrolidine]-1-yl]acetamide (CID 70782211) is 2-[1'-(2-methylfuran-3-carbonyl)-2-oxospiro[indole-3,3'-pyrrolidine]-1-yl]acetamide.
What is the SMILES notation for 2-[1'-(2-methylfuran-3-carbonyl)-2-oxospiro[indole-3,3'-pyrrolidine]-1-yl]acetamide?
The canonical SMILES for 2-[1'-(2-methylfuran-3-carbonyl)-2-oxospiro[indole-3,3'-pyrrolidine]-1-yl]acetamide is Cc1occc1C(=O)N1CCC2(C1)C(=O)N(CC(N)=O)c1ccccc12.
What is the InChIKey of 2-[1'-(2-methylfuran-3-carbonyl)-2-oxospiro[indole-3,3'-pyrrolidine]-1-yl]acetamide?
The InChIKey is SLLMBPZYUBOQDO-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H19N3O4/c1-12-13(6-9-26-12)17(24)21-8-7-19(11-21)14-4-2-3-5-15(14)22(18(19)25)10-16(20)23/h2-6,9H,7-8,10-11H2,1H3,(H2,20,23).
What are the key properties of 2-[1'-(2-methylfuran-3-carbonyl)-2-oxospiro[indole-3,3'-pyrrolidine]-1-yl]acetamide?
2-[1'-(2-methylfuran-3-carbonyl)-2-oxospiro[indole-3,3'-pyrrolidine]-1-yl]acetamide has a molecular weight of 353.38 g/mol, XLogP of 1.20, 3 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[1'-(2-methylfuran-3-carbonyl)-2-oxospiro[indole-3,3'-pyrrolidine]-1-yl]acetamide is sourced from PubChem (CID 70782211), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).