C19H25N5O — CID 70782242
5-[(4,5-dimethylfuran-2-yl)methyl]-4-(1-propylimidazol-2-yl)-1,4,6,7-tetrahydroimidazo[4,5-c]pyridine (PubChem CID 70782242) has the molecular formula C19H25N5O and a molecular weight of 339.44 g/mol. Its IUPAC name is 5-[(4,5-dimethylfuran-2-yl)methyl]-4-(1-propylimidazol-2-yl)-1,4,6,7-tetrahydroimidazo[4,5-c]pyridine.
| Compound Name | 5-[(4,5-dimethylfuran-2-yl)methyl]-4-(1-propylimidazol-2-yl)-1,4,6,7-tetrahydroimidazo[4,5-c]pyridine |
|---|---|
| PubChem CID | 70782242 |
| Molecular Formula | C19H25N5O |
| Molecular Weight | 339.44 g/mol |
| Exact Mass | 339.21 |
| IUPAC Name | 5-[(4,5-dimethylfuran-2-yl)methyl]-4-(1-propylimidazol-2-yl)-1,4,6,7-tetrahydroimidazo[4,5-c]pyridine |
| SMILES | CCCn1ccnc1C1c2nc[nH]c2CCN1Cc1cc(C)c(C)o1 |
| InChI | InChI=1S/C19H25N5O/c1-4-7-23-9-6-20-19(23)18-17-16(21-12-22-17)5-8-24(18)11-15-10-13(2)14(3)25-15/h6,9-10,12,18H,4-5,7-8,11H2,1-3H3,(H,21,22) |
| InChIKey | PIAWNPKXDVACNI-UHFFFAOYSA-N |
| XLogP | 3.37 |
| TPSA | 62.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.44 |
| LogP ≤ 5 | 3.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |