About 5-ethyl-N-[3-(oxolan-3-yl)propyl]pyrazolo[1,5-a]pyrimidin-7-amine
5-ethyl-N-[3-(oxolan-3-yl)propyl]pyrazolo[1,5-a]pyrimidin-7-amine (PubChem CID 70782443) has the molecular formula C15H22N4O
and a molecular weight of 274.37 g/mol. Its IUPAC name is 5-ethyl-N-[3-(oxolan-3-yl)propyl]pyrazolo[1,5-a]pyrimidin-7-amine.
Molecular Properties
| Compound Name | 5-ethyl-N-[3-(oxolan-3-yl)propyl]pyrazolo[1,5-a]pyrimidin-7-amine |
| PubChem CID | 70782443 |
| Molecular Formula | C15H22N4O |
| Molecular Weight | 274.37 g/mol |
| Exact Mass | 274.18 |
| IUPAC Name | 5-ethyl-N-[3-(oxolan-3-yl)propyl]pyrazolo[1,5-a]pyrimidin-7-amine |
| SMILES | CCc1cc(NCCCC2CCOC2)n2nccc2n1 |
| InChI | InChI=1S/C15H22N4O/c1-2-13-10-15(19-14(18-13)5-8-17-19)16-7-3-4-12-6-9-20-11-12/h5,8,10,12,16H,2-4,6-7,9,11H2,1H3 |
| InChIKey | WUWLWLGAPLYNFQ-UHFFFAOYSA-N |
| XLogP | 2.52 |
| TPSA | 51.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 274.37 |
| LogP ≤ 5 | 2.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 5-ethyl-N-[3-(oxolan-3-yl)propyl]pyrazolo[1,5-a]pyrimidin-7-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-ethyl-N-[3-(oxolan-3-yl)propyl]pyrazolo[1,5-a]pyrimidin-7-amine?
The IUPAC name of 5-ethyl-N-[3-(oxolan-3-yl)propyl]pyrazolo[1,5-a]pyrimidin-7-amine (CID 70782443) is 5-ethyl-N-[3-(oxolan-3-yl)propyl]pyrazolo[1,5-a]pyrimidin-7-amine.
What is the SMILES notation for 5-ethyl-N-[3-(oxolan-3-yl)propyl]pyrazolo[1,5-a]pyrimidin-7-amine?
The canonical SMILES for 5-ethyl-N-[3-(oxolan-3-yl)propyl]pyrazolo[1,5-a]pyrimidin-7-amine is CCc1cc(NCCCC2CCOC2)n2nccc2n1.
What is the InChIKey of 5-ethyl-N-[3-(oxolan-3-yl)propyl]pyrazolo[1,5-a]pyrimidin-7-amine?
The InChIKey is WUWLWLGAPLYNFQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H22N4O/c1-2-13-10-15(19-14(18-13)5-8-17-19)16-7-3-4-12-6-9-20-11-12/h5,8,10,12,16H,2-4,6-7,9,11H2,1H3.
What are the key properties of 5-ethyl-N-[3-(oxolan-3-yl)propyl]pyrazolo[1,5-a]pyrimidin-7-amine?
5-ethyl-N-[3-(oxolan-3-yl)propyl]pyrazolo[1,5-a]pyrimidin-7-amine has a molecular weight of 274.37 g/mol, XLogP of 2.52, 6 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 5-ethyl-N-[3-(oxolan-3-yl)propyl]pyrazolo[1,5-a]pyrimidin-7-amine is sourced from PubChem (CID 70782443), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).