C22H34N2O2 — CID 70783649
(2R)-N-[(1-benzylpiperidin-4-yl)methyl]-2-cyclohexyl-2-hydroxy-N-methylacetamide (PubChem CID 70783649) has the molecular formula C22H34N2O2 and a molecular weight of 358.53 g/mol. Its IUPAC name is (2R)-N-[(1-benzylpiperidin-4-yl)methyl]-2-cyclohexyl-2-hydroxy-N-methylacetamide.
| Compound Name | (2R)-N-[(1-benzylpiperidin-4-yl)methyl]-2-cyclohexyl-2-hydroxy-N-methylacetamide |
|---|---|
| PubChem CID | 70783649 |
| Molecular Formula | C22H34N2O2 |
| Molecular Weight | 358.53 g/mol |
| Exact Mass | 358.26 |
| IUPAC Name | (2R)-N-[(1-benzylpiperidin-4-yl)methyl]-2-cyclohexyl-2-hydroxy-N-methylacetamide |
| SMILES | CN(CC1CCN(Cc2ccccc2)CC1)C(=O)[C@H](O)C1CCCCC1 |
| InChI | InChI=1S/C22H34N2O2/c1-23(22(26)21(25)20-10-6-3-7-11-20)16-19-12-14-24(15-13-19)17-18-8-4-2-5-9-18/h2,4-5,8-9,19-21,25H,3,6-7,10-17H2,1H3/t21-/m1/s1 |
| InChIKey | ZQDPIRXQQXEBDJ-OAQYLSRUSA-N |
| XLogP | 3.30 |
| TPSA | 43.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.53 |
| LogP ≤ 5 | 3.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |