C18H24ClFN2O — CID 70783740
1-[2-[1-[(3-chloro-4-fluorophenyl)methyl]piperidin-2-yl]ethyl]pyrrolidin-2-one (PubChem CID 70783740) has the molecular formula C18H24ClFN2O and a molecular weight of 338.85 g/mol. Its IUPAC name is 1-[2-[1-[(3-chloro-4-fluorophenyl)methyl]piperidin-2-yl]ethyl]pyrrolidin-2-one.
| Compound Name | 1-[2-[1-[(3-chloro-4-fluorophenyl)methyl]piperidin-2-yl]ethyl]pyrrolidin-2-one |
|---|---|
| PubChem CID | 70783740 |
| Molecular Formula | C18H24ClFN2O |
| Molecular Weight | 338.85 g/mol |
| Exact Mass | 338.16 |
| IUPAC Name | 1-[2-[1-[(3-chloro-4-fluorophenyl)methyl]piperidin-2-yl]ethyl]pyrrolidin-2-one |
| SMILES | O=C1CCCN1CCC1CCCCN1Cc1ccc(F)c(Cl)c1 |
| InChI | InChI=1S/C18H24ClFN2O/c19-16-12-14(6-7-17(16)20)13-22-9-2-1-4-15(22)8-11-21-10-3-5-18(21)23/h6-7,12,15H,1-5,8-11,13H2 |
| InChIKey | OGULGTCNOMRSIM-UHFFFAOYSA-N |
| XLogP | 3.85 |
| TPSA | 23.55 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.85 |
| LogP ≤ 5 | 3.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |