C15H20O3 — CID 7078375
(1S,3R,7R,9R,13R)-9,13-dimethyl-4-methylidene-6,14-dioxatetracyclo[7.5.0.01,13.03,7]tetradecan-5-one (PubChem CID 7078375) has the molecular formula C15H20O3 and a molecular weight of 248.32 g/mol. Its IUPAC name is (1S,3R,7R,9R,13R)-9,13-dimethyl-4-methylidene-6,14-dioxatetracyclo[7.5.0.01,13.03,7]tetradecan-5-one.
| Compound Name | (1S,3R,7R,9R,13R)-9,13-dimethyl-4-methylidene-6,14-dioxatetracyclo[7.5.0.01,13.03,7]tetradecan-5-one |
|---|---|
| PubChem CID | 7078375 |
| Molecular Formula | C15H20O3 |
| Molecular Weight | 248.32 g/mol |
| Exact Mass | 248.14 |
| IUPAC Name | (1S,3R,7R,9R,13R)-9,13-dimethyl-4-methylidene-6,14-dioxatetracyclo[7.5.0.01,13.03,7]tetradecan-5-one |
| SMILES | C=C1C(=O)O[C@@H]2C[C@@]3(C)CCC[C@@]4(C)O[C@@]34C[C@H]12 |
| InChI | InChI=1S/C15H20O3/c1-9-10-7-15-13(2,8-11(10)17-12(9)16)5-4-6-14(15,3)18-15/h10-11H,1,4-8H2,2-3H3/t10-,11-,13-,14-,15+/m1/s1 |
| InChIKey | BSZNUAGWEMADPW-BBIZWXPBSA-N |
| XLogP | 2.60 |
| TPSA | 38.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 248.32 |
| LogP ≤ 5 | 2.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|