C16H23N3O4S — CID 70783887
3-[(4aR,7aS)-1-methyl-6,6-dioxo-2,3,4a,5,7,7a-hexahydrothieno[3,4-b]pyrazine-4-carbonyl]-1,4,6-trimethylpyridin-2-one (PubChem CID 70783887) has the molecular formula C16H23N3O4S and a molecular weight of 353.44 g/mol. Its IUPAC name is 3-[(4aR,7aS)-1-methyl-6,6-dioxo-2,3,4a,5,7,7a-hexahydrothieno[3,4-b]pyrazine-4-carbonyl]-1,4,6-trimethylpyridin-2-one.
| Compound Name | 3-[(4aR,7aS)-1-methyl-6,6-dioxo-2,3,4a,5,7,7a-hexahydrothieno[3,4-b]pyrazine-4-carbonyl]-1,4,6-trimethylpyridin-2-one |
|---|---|
| PubChem CID | 70783887 |
| Molecular Formula | C16H23N3O4S |
| Molecular Weight | 353.44 g/mol |
| Exact Mass | 353.14 |
| IUPAC Name | 3-[(4aR,7aS)-1-methyl-6,6-dioxo-2,3,4a,5,7,7a-hexahydrothieno[3,4-b]pyrazine-4-carbonyl]-1,4,6-trimethylpyridin-2-one |
| SMILES | Cc1cc(C)n(C)c(=O)c1C(=O)N1CCN(C)[C@@H]2CS(=O)(=O)C[C@@H]21 |
| InChI | InChI=1S/C16H23N3O4S/c1-10-7-11(2)18(4)15(20)14(10)16(21)19-6-5-17(3)12-8-24(22,23)9-13(12)19/h7,12-13H,5-6,8-9H2,1-4H3/t12-,13+/m1/s1 |
| InChIKey | ROBYDMFAQVIKRD-OLZOCXBDSA-N |
| XLogP | -0.44 |
| TPSA | 79.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.44 |
| LogP ≤ 5 | -0.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |