C16H16ClN3O — CID 70784040
4-[(6-chloro-1,3,4,5-tetrahydropyrido[4,3-b]indol-2-yl)methyl]-2-methyl-1,3-oxazole (PubChem CID 70784040) has the molecular formula C16H16ClN3O and a molecular weight of 301.78 g/mol. Its IUPAC name is 4-[(6-chloro-1,3,4,5-tetrahydropyrido[4,3-b]indol-2-yl)methyl]-2-methyl-1,3-oxazole.
| Compound Name | 4-[(6-chloro-1,3,4,5-tetrahydropyrido[4,3-b]indol-2-yl)methyl]-2-methyl-1,3-oxazole |
|---|---|
| PubChem CID | 70784040 |
| Molecular Formula | C16H16ClN3O |
| Molecular Weight | 301.78 g/mol |
| Exact Mass | 301.10 |
| IUPAC Name | 4-[(6-chloro-1,3,4,5-tetrahydropyrido[4,3-b]indol-2-yl)methyl]-2-methyl-1,3-oxazole |
| SMILES | Cc1nc(CN2CCc3[nH]c4c(Cl)cccc4c3C2)co1 |
| InChI | InChI=1S/C16H16ClN3O/c1-10-18-11(9-21-10)7-20-6-5-15-13(8-20)12-3-2-4-14(17)16(12)19-15/h2-4,9,19H,5-8H2,1H3 |
| InChIKey | GHKTUKPUYKZSBM-UHFFFAOYSA-N |
| XLogP | 3.68 |
| TPSA | 45.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.78 |
| LogP ≤ 5 | 3.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|