About 4-[(2-fluoro-4,5-dimethoxyphenyl)methyl]-3-methyl-1-(2-methylpropyl)piperazin-2-one
4-[(2-fluoro-4,5-dimethoxyphenyl)methyl]-3-methyl-1-(2-methylpropyl)piperazin-2-one (PubChem CID 70784052) has the molecular formula C18H27FN2O3
and a molecular weight of 338.42 g/mol. Its IUPAC name is 4-[(2-fluoro-4,5-dimethoxyphenyl)methyl]-3-methyl-1-(2-methylpropyl)piperazin-2-one.
Molecular Properties
| Compound Name | 4-[(2-fluoro-4,5-dimethoxyphenyl)methyl]-3-methyl-1-(2-methylpropyl)piperazin-2-one |
| PubChem CID | 70784052 |
| Molecular Formula | C18H27FN2O3 |
| Molecular Weight | 338.42 g/mol |
| Exact Mass | 338.20 |
| IUPAC Name | 4-[(2-fluoro-4,5-dimethoxyphenyl)methyl]-3-methyl-1-(2-methylpropyl)piperazin-2-one |
| SMILES | COc1cc(F)c(CN2CCN(CC(C)C)C(=O)C2C)cc1OC |
| InChI | InChI=1S/C18H27FN2O3/c1-12(2)10-21-7-6-20(13(3)18(21)22)11-14-8-16(23-4)17(24-5)9-15(14)19/h8-9,12-13H,6-7,10-11H2,1-5H3 |
| InChIKey | YTDNNMCVRMOSDE-UHFFFAOYSA-N |
| XLogP | 2.53 |
| TPSA | 42.01 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 338.42 |
| LogP ≤ 5 | 2.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 4-[(2-fluoro-4,5-dimethoxyphenyl)methyl]-3-methyl-1-(2-methylpropyl)piperazin-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-[(2-fluoro-4,5-dimethoxyphenyl)methyl]-3-methyl-1-(2-methylpropyl)piperazin-2-one?
The IUPAC name of 4-[(2-fluoro-4,5-dimethoxyphenyl)methyl]-3-methyl-1-(2-methylpropyl)piperazin-2-one (CID 70784052) is 4-[(2-fluoro-4,5-dimethoxyphenyl)methyl]-3-methyl-1-(2-methylpropyl)piperazin-2-one.
What is the SMILES notation for 4-[(2-fluoro-4,5-dimethoxyphenyl)methyl]-3-methyl-1-(2-methylpropyl)piperazin-2-one?
The canonical SMILES for 4-[(2-fluoro-4,5-dimethoxyphenyl)methyl]-3-methyl-1-(2-methylpropyl)piperazin-2-one is COc1cc(F)c(CN2CCN(CC(C)C)C(=O)C2C)cc1OC.
What is the InChIKey of 4-[(2-fluoro-4,5-dimethoxyphenyl)methyl]-3-methyl-1-(2-methylpropyl)piperazin-2-one?
The InChIKey is YTDNNMCVRMOSDE-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H27FN2O3/c1-12(2)10-21-7-6-20(13(3)18(21)22)11-14-8-16(23-4)17(24-5)9-15(14)19/h8-9,12-13H,6-7,10-11H2,1-5H3.
What are the key properties of 4-[(2-fluoro-4,5-dimethoxyphenyl)methyl]-3-methyl-1-(2-methylpropyl)piperazin-2-one?
4-[(2-fluoro-4,5-dimethoxyphenyl)methyl]-3-methyl-1-(2-methylpropyl)piperazin-2-one has a molecular weight of 338.42 g/mol, XLogP of 2.53, 6 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[(2-fluoro-4,5-dimethoxyphenyl)methyl]-3-methyl-1-(2-methylpropyl)piperazin-2-one is sourced from PubChem (CID 70784052), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).