C17H27N7O — CID 70784763
3-[[5-[(1-ethylpyrazol-4-yl)methyl]-4,6,7,8-tetrahydropyrazolo[1,5-a][1,4]diazepin-2-yl]methyl]-1,1-dimethylurea (PubChem CID 70784763) has the molecular formula C17H27N7O and a molecular weight of 345.45 g/mol. Its IUPAC name is 3-[[5-[(1-ethylpyrazol-4-yl)methyl]-4,6,7,8-tetrahydropyrazolo[1,5-a][1,4]diazepin-2-yl]methyl]-1,1-dimethylurea.
| Compound Name | 3-[[5-[(1-ethylpyrazol-4-yl)methyl]-4,6,7,8-tetrahydropyrazolo[1,5-a][1,4]diazepin-2-yl]methyl]-1,1-dimethylurea |
|---|---|
| PubChem CID | 70784763 |
| Molecular Formula | C17H27N7O |
| Molecular Weight | 345.45 g/mol |
| Exact Mass | 345.23 |
| IUPAC Name | 3-[[5-[(1-ethylpyrazol-4-yl)methyl]-4,6,7,8-tetrahydropyrazolo[1,5-a][1,4]diazepin-2-yl]methyl]-1,1-dimethylurea |
| SMILES | CCn1cc(CN2CCCn3nc(CNC(=O)N(C)C)cc3C2)cn1 |
| InChI | InChI=1S/C17H27N7O/c1-4-23-12-14(9-19-23)11-22-6-5-7-24-16(13-22)8-15(20-24)10-18-17(25)21(2)3/h8-9,12H,4-7,10-11,13H2,1-3H3,(H,18,25) |
| InChIKey | FDSLEBNOJMZWOY-UHFFFAOYSA-N |
| XLogP | 1.28 |
| TPSA | 71.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.45 |
| LogP ≤ 5 | 1.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |