C21H28N2O4 — CID 70784930
3-(3-methylbut-2-enyl)-1-(2-oxo-5,6,7,8-tetrahydro-1H-quinoline-3-carbonyl)piperidine-3-carboxylic acid (PubChem CID 70784930) has the molecular formula C21H28N2O4 and a molecular weight of 372.47 g/mol. Its IUPAC name is 3-(3-methylbut-2-enyl)-1-(2-oxo-5,6,7,8-tetrahydro-1H-quinoline-3-carbonyl)piperidine-3-carboxylic acid.
| Compound Name | 3-(3-methylbut-2-enyl)-1-(2-oxo-5,6,7,8-tetrahydro-1H-quinoline-3-carbonyl)piperidine-3-carboxylic acid |
|---|---|
| PubChem CID | 70784930 |
| Molecular Formula | C21H28N2O4 |
| Molecular Weight | 372.47 g/mol |
| Exact Mass | 372.20 |
| IUPAC Name | 3-(3-methylbut-2-enyl)-1-(2-oxo-5,6,7,8-tetrahydro-1H-quinoline-3-carbonyl)piperidine-3-carboxylic acid |
| SMILES | CC(C)=CCC1(C(=O)O)CCCN(C(=O)c2cc3c([nH]c2=O)CCCC3)C1 |
| InChI | InChI=1S/C21H28N2O4/c1-14(2)8-10-21(20(26)27)9-5-11-23(13-21)19(25)16-12-15-6-3-4-7-17(15)22-18(16)24/h8,12H,3-7,9-11,13H2,1-2H3,(H,22,24)(H,26,27) |
| InChIKey | OCSMLIINLOUSJM-UHFFFAOYSA-N |
| XLogP | 2.92 |
| TPSA | 90.47 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.47 |
| LogP ≤ 5 | 2.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|