C14H18N4O2 — CID 70785517
5-[(3aS,6aS)-3,3a,4,5,6,6a-hexahydro-2H-pyrrolo[2,3-c]pyrrole-1-carbonyl]-2-cyclopropyl-1H-pyrimidin-6-one (PubChem CID 70785517) has the molecular formula C14H18N4O2 and a molecular weight of 274.32 g/mol. Its IUPAC name is 5-[(3aS,6aS)-3,3a,4,5,6,6a-hexahydro-2H-pyrrolo[2,3-c]pyrrole-1-carbonyl]-2-cyclopropyl-1H-pyrimidin-6-one.
| Compound Name | 5-[(3aS,6aS)-3,3a,4,5,6,6a-hexahydro-2H-pyrrolo[2,3-c]pyrrole-1-carbonyl]-2-cyclopropyl-1H-pyrimidin-6-one |
|---|---|
| PubChem CID | 70785517 |
| Molecular Formula | C14H18N4O2 |
| Molecular Weight | 274.32 g/mol |
| Exact Mass | 274.14 |
| IUPAC Name | 5-[(3aS,6aS)-3,3a,4,5,6,6a-hexahydro-2H-pyrrolo[2,3-c]pyrrole-1-carbonyl]-2-cyclopropyl-1H-pyrimidin-6-one |
| SMILES | O=C(c1cnc(C2CC2)[nH]c1=O)N1CC[C@H]2CNC[C@H]21 |
| InChI | InChI=1S/C14H18N4O2/c19-13-10(6-16-12(17-13)8-1-2-8)14(20)18-4-3-9-5-15-7-11(9)18/h6,8-9,11,15H,1-5,7H2,(H,16,17,19)/t9-,11+/m0/s1 |
| InChIKey | BEOWOEZLJHZABU-GXSJLCMTSA-N |
| XLogP | 0.08 |
| TPSA | 78.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.32 |
| LogP ≤ 5 | 0.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |