C23H34N4O — CID 70785584
1-[6-methyl-3-[(4-propan-2-ylpiperazin-1-yl)methyl]quinolin-2-yl]piperidin-3-ol (PubChem CID 70785584) has the molecular formula C23H34N4O and a molecular weight of 382.55 g/mol. Its IUPAC name is 1-[6-methyl-3-[(4-propan-2-ylpiperazin-1-yl)methyl]quinolin-2-yl]piperidin-3-ol.
| Compound Name | 1-[6-methyl-3-[(4-propan-2-ylpiperazin-1-yl)methyl]quinolin-2-yl]piperidin-3-ol |
|---|---|
| PubChem CID | 70785584 |
| Molecular Formula | C23H34N4O |
| Molecular Weight | 382.55 g/mol |
| Exact Mass | 382.27 |
| IUPAC Name | 1-[6-methyl-3-[(4-propan-2-ylpiperazin-1-yl)methyl]quinolin-2-yl]piperidin-3-ol |
| SMILES | Cc1ccc2nc(N3CCCC(O)C3)c(CN3CCN(C(C)C)CC3)cc2c1 |
| InChI | InChI=1S/C23H34N4O/c1-17(2)26-11-9-25(10-12-26)15-20-14-19-13-18(3)6-7-22(19)24-23(20)27-8-4-5-21(28)16-27/h6-7,13-14,17,21,28H,4-5,8-12,15-16H2,1-3H3 |
| InChIKey | RFHBMPWBRQYFPG-UHFFFAOYSA-N |
| XLogP | 3.03 |
| TPSA | 42.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.55 |
| LogP ≤ 5 | 3.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |