C21H28N4O — CID 70785676
N-[(5-cyclohexyl-4,6,7,8-tetrahydropyrazolo[1,5-a][1,4]diazepin-2-yl)methyl]benzamide (PubChem CID 70785676) has the molecular formula C21H28N4O and a molecular weight of 352.48 g/mol. Its IUPAC name is N-[(5-cyclohexyl-4,6,7,8-tetrahydropyrazolo[1,5-a][1,4]diazepin-2-yl)methyl]benzamide.
| Compound Name | N-[(5-cyclohexyl-4,6,7,8-tetrahydropyrazolo[1,5-a][1,4]diazepin-2-yl)methyl]benzamide |
|---|---|
| PubChem CID | 70785676 |
| Molecular Formula | C21H28N4O |
| Molecular Weight | 352.48 g/mol |
| Exact Mass | 352.23 |
| IUPAC Name | N-[(5-cyclohexyl-4,6,7,8-tetrahydropyrazolo[1,5-a][1,4]diazepin-2-yl)methyl]benzamide |
| SMILES | O=C(NCc1cc2n(n1)CCCN(C1CCCCC1)C2)c1ccccc1 |
| InChI | InChI=1S/C21H28N4O/c26-21(17-8-3-1-4-9-17)22-15-18-14-20-16-24(12-7-13-25(20)23-18)19-10-5-2-6-11-19/h1,3-4,8-9,14,19H,2,5-7,10-13,15-16H2,(H,22,26) |
| InChIKey | DGZMIDYJLPLDCJ-UHFFFAOYSA-N |
| XLogP | 3.35 |
| TPSA | 50.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.48 |
| LogP ≤ 5 | 3.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |