C19H26N8 — CID 70785858
N-[(5-cyclohexyl-4,6,7,8-tetrahydropyrazolo[1,5-a][1,4]diazepin-2-yl)methyl]-7H-purin-6-amine (PubChem CID 70785858) has the molecular formula C19H26N8 and a molecular weight of 366.47 g/mol. Its IUPAC name is N-[(5-cyclohexyl-4,6,7,8-tetrahydropyrazolo[1,5-a][1,4]diazepin-2-yl)methyl]-7H-purin-6-amine.
| Compound Name | N-[(5-cyclohexyl-4,6,7,8-tetrahydropyrazolo[1,5-a][1,4]diazepin-2-yl)methyl]-7H-purin-6-amine |
|---|---|
| PubChem CID | 70785858 |
| Molecular Formula | C19H26N8 |
| Molecular Weight | 366.47 g/mol |
| Exact Mass | 366.23 |
| IUPAC Name | N-[(5-cyclohexyl-4,6,7,8-tetrahydropyrazolo[1,5-a][1,4]diazepin-2-yl)methyl]-7H-purin-6-amine |
| SMILES | c1nc(NCc2cc3n(n2)CCCN(C2CCCCC2)C3)c2[nH]cnc2n1 |
| InChI | InChI=1S/C19H26N8/c1-2-5-15(6-3-1)26-7-4-8-27-16(11-26)9-14(25-27)10-20-18-17-19(22-12-21-17)24-13-23-18/h9,12-13,15H,1-8,10-11H2,(H2,20,21,22,23,24) |
| InChIKey | PHDQHBJLQZORJX-UHFFFAOYSA-N |
| XLogP | 2.70 |
| TPSA | 87.55 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.47 |
| LogP ≤ 5 | 2.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |