C20H25F3N2O — CID 70786326
2-(cyclopropylmethyl)-9-[(2,4,5-trifluorophenyl)methyl]-2,9-diazaspiro[5.5]undecan-3-one (PubChem CID 70786326) has the molecular formula C20H25F3N2O and a molecular weight of 366.43 g/mol. Its IUPAC name is 2-(cyclopropylmethyl)-9-[(2,4,5-trifluorophenyl)methyl]-2,9-diazaspiro[5.5]undecan-3-one.
| Compound Name | 2-(cyclopropylmethyl)-9-[(2,4,5-trifluorophenyl)methyl]-2,9-diazaspiro[5.5]undecan-3-one |
|---|---|
| PubChem CID | 70786326 |
| Molecular Formula | C20H25F3N2O |
| Molecular Weight | 366.43 g/mol |
| Exact Mass | 366.19 |
| IUPAC Name | 2-(cyclopropylmethyl)-9-[(2,4,5-trifluorophenyl)methyl]-2,9-diazaspiro[5.5]undecan-3-one |
| SMILES | O=C1CCC2(CCN(Cc3cc(F)c(F)cc3F)CC2)CN1CC1CC1 |
| InChI | InChI=1S/C20H25F3N2O/c21-16-10-18(23)17(22)9-15(16)12-24-7-5-20(6-8-24)4-3-19(26)25(13-20)11-14-1-2-14/h9-10,14H,1-8,11-13H2 |
| InChIKey | GVOKHGPXNOEKKX-UHFFFAOYSA-N |
| XLogP | 3.72 |
| TPSA | 23.55 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.43 |
| LogP ≤ 5 | 3.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|