C17H22N4O4S — CID 70786420
[(4aR,7aS)-1-ethyl-6,6-dioxo-2,3,4a,5,7,7a-hexahydrothieno[3,4-b]pyrazin-4-yl]-[5-(5-methylfuran-2-yl)-1H-pyrazol-3-yl]methanone (PubChem CID 70786420) has the molecular formula C17H22N4O4S and a molecular weight of 378.45 g/mol. Its IUPAC name is [(4aR,7aS)-1-ethyl-6,6-dioxo-2,3,4a,5,7,7a-hexahydrothieno[3,4-b]pyrazin-4-yl]-[5-(5-methylfuran-2-yl)-1H-pyrazol-3-yl]methanone.
| Compound Name | [(4aR,7aS)-1-ethyl-6,6-dioxo-2,3,4a,5,7,7a-hexahydrothieno[3,4-b]pyrazin-4-yl]-[5-(5-methylfuran-2-yl)-1H-pyrazol-3-yl]methanone |
|---|---|
| PubChem CID | 70786420 |
| Molecular Formula | C17H22N4O4S |
| Molecular Weight | 378.45 g/mol |
| Exact Mass | 378.14 |
| IUPAC Name | [(4aR,7aS)-1-ethyl-6,6-dioxo-2,3,4a,5,7,7a-hexahydrothieno[3,4-b]pyrazin-4-yl]-[5-(5-methylfuran-2-yl)-1H-pyrazol-3-yl]methanone |
| SMILES | CCN1CCN(C(=O)c2cc(-c3ccc(C)o3)[nH]n2)[C@H]2CS(=O)(=O)C[C@H]21 |
| InChI | InChI=1S/C17H22N4O4S/c1-3-20-6-7-21(15-10-26(23,24)9-14(15)20)17(22)13-8-12(18-19-13)16-5-4-11(2)25-16/h4-5,8,14-15H,3,6-7,9-10H2,1-2H3,(H,18,19)/t14-,15+/m1/s1 |
| InChIKey | AHGPHRWPXWBGER-CABCVRRESA-N |
| XLogP | 0.92 |
| TPSA | 99.51 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.45 |
| LogP ≤ 5 | 0.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |