C22H27N3O4 — CID 7078669
(1S,9S)-N-[2-(3,4-dimethoxyphenyl)ethyl]-6-oxo-7,11-diazatricyclo[7.3.1.02,7]trideca-2,4-diene-11-carboxamide (PubChem CID 7078669) has the molecular formula C22H27N3O4 and a molecular weight of 397.48 g/mol. Its IUPAC name is (1S,9S)-N-[2-(3,4-dimethoxyphenyl)ethyl]-6-oxo-7,11-diazatricyclo[7.3.1.02,7]trideca-2,4-diene-11-carboxamide.
| Compound Name | (1S,9S)-N-[2-(3,4-dimethoxyphenyl)ethyl]-6-oxo-7,11-diazatricyclo[7.3.1.02,7]trideca-2,4-diene-11-carboxamide |
|---|---|
| PubChem CID | 7078669 |
| Molecular Formula | C22H27N3O4 |
| Molecular Weight | 397.48 g/mol |
| Exact Mass | 397.20 |
| IUPAC Name | (1S,9S)-N-[2-(3,4-dimethoxyphenyl)ethyl]-6-oxo-7,11-diazatricyclo[7.3.1.02,7]trideca-2,4-diene-11-carboxamide |
| SMILES | COc1ccc(CCNC(=O)N2C[C@H]3C[C@@H](C2)c2cccc(=O)n2C3)cc1OC |
| InChI | InChI=1S/C22H27N3O4/c1-28-19-7-6-15(11-20(19)29-2)8-9-23-22(27)24-12-16-10-17(14-24)18-4-3-5-21(26)25(18)13-16/h3-7,11,16-17H,8-10,12-14H2,1-2H3,(H,23,27)/t16-,17+/m1/s1 |
| InChIKey | BGHBHMZSUDISEL-SJORKVTESA-N |
| XLogP | 2.24 |
| TPSA | 72.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.48 |
| LogP ≤ 5 | 2.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |