C17H20N2O2S — CID 70786893
1-[3-(pyridin-3-ylmethoxy)piperidin-1-yl]-2-thiophen-2-ylethanone (PubChem CID 70786893) has the molecular formula C17H20N2O2S and a molecular weight of 316.43 g/mol. Its IUPAC name is 1-[3-(pyridin-3-ylmethoxy)piperidin-1-yl]-2-thiophen-2-ylethanone.
| Compound Name | 1-[3-(pyridin-3-ylmethoxy)piperidin-1-yl]-2-thiophen-2-ylethanone |
|---|---|
| PubChem CID | 70786893 |
| Molecular Formula | C17H20N2O2S |
| Molecular Weight | 316.43 g/mol |
| Exact Mass | 316.12 |
| IUPAC Name | 1-[3-(pyridin-3-ylmethoxy)piperidin-1-yl]-2-thiophen-2-ylethanone |
| SMILES | O=C(Cc1cccs1)N1CCCC(OCc2cccnc2)C1 |
| InChI | InChI=1S/C17H20N2O2S/c20-17(10-16-6-3-9-22-16)19-8-2-5-15(12-19)21-13-14-4-1-7-18-11-14/h1,3-4,6-7,9,11,15H,2,5,8,10,12-13H2 |
| InChIKey | CDIVVBCKWLKJRW-UHFFFAOYSA-N |
| XLogP | 2.89 |
| TPSA | 42.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.43 |
| LogP ≤ 5 | 2.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |