C15H21N5OS — CID 70787719
1-(4-aminocyclohexyl)-N-[(3-methylthiophen-2-yl)methyl]triazole-4-carboxamide (PubChem CID 70787719) has the molecular formula C15H21N5OS and a molecular weight of 319.43 g/mol. Its IUPAC name is 1-(4-aminocyclohexyl)-N-[(3-methylthiophen-2-yl)methyl]triazole-4-carboxamide.
| Compound Name | 1-(4-aminocyclohexyl)-N-[(3-methylthiophen-2-yl)methyl]triazole-4-carboxamide |
|---|---|
| PubChem CID | 70787719 |
| Molecular Formula | C15H21N5OS |
| Molecular Weight | 319.43 g/mol |
| Exact Mass | 319.15 |
| IUPAC Name | 1-(4-aminocyclohexyl)-N-[(3-methylthiophen-2-yl)methyl]triazole-4-carboxamide |
| SMILES | Cc1ccsc1CNC(=O)c1cn(C2CCC(N)CC2)nn1 |
| InChI | InChI=1S/C15H21N5OS/c1-10-6-7-22-14(10)8-17-15(21)13-9-20(19-18-13)12-4-2-11(16)3-5-12/h6-7,9,11-12H,2-5,8,16H2,1H3,(H,17,21) |
| InChIKey | YATORCBQLMIHLQ-UHFFFAOYSA-N |
| XLogP | 2.02 |
| TPSA | 85.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.43 |
| LogP ≤ 5 | 2.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |