About 1-(1-adamantyl)-3-[[(2S,4S)-4-fluoropyrrolidin-2-yl]methyl]urea
1-(1-adamantyl)-3-[[(2S,4S)-4-fluoropyrrolidin-2-yl]methyl]urea (PubChem CID 70788671) has the molecular formula C16H26FN3O
and a molecular weight of 295.40 g/mol. Its IUPAC name is 1-(1-adamantyl)-3-[[(2S,4S)-4-fluoropyrrolidin-2-yl]methyl]urea.
Molecular Properties
| Compound Name | 1-(1-adamantyl)-3-[[(2S,4S)-4-fluoropyrrolidin-2-yl]methyl]urea |
| PubChem CID | 70788671 |
| Molecular Formula | C16H26FN3O |
| Molecular Weight | 295.40 g/mol |
| Exact Mass | 295.21 |
| IUPAC Name | 1-(1-adamantyl)-3-[[(2S,4S)-4-fluoropyrrolidin-2-yl]methyl]urea |
| SMILES | O=C(NC[C@@H]1C[C@H](F)CN1)NC12CC3CC(CC(C3)C1)C2 |
| InChI | InChI=1S/C16H26FN3O/c17-13-4-14(18-8-13)9-19-15(21)20-16-5-10-1-11(6-16)3-12(2-10)7-16/h10-14,18H,1-9H2,(H2,19,20,21)/t10?,11?,12?,13-,14-,16?/m0/s1 |
| InChIKey | RLTKAZJAMAAWML-FUDOWXGNSA-N |
| XLogP | 1.95 |
| TPSA | 53.16 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 295.40 |
| LogP ≤ 5 | 1.95 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 1-(1-adamantyl)-3-[[(2S,4S)-4-fluoropyrrolidin-2-yl]methyl]urea with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(1-adamantyl)-3-[[(2S,4S)-4-fluoropyrrolidin-2-yl]methyl]urea?
The IUPAC name of 1-(1-adamantyl)-3-[[(2S,4S)-4-fluoropyrrolidin-2-yl]methyl]urea (CID 70788671) is 1-(1-adamantyl)-3-[[(2S,4S)-4-fluoropyrrolidin-2-yl]methyl]urea.
What is the SMILES notation for 1-(1-adamantyl)-3-[[(2S,4S)-4-fluoropyrrolidin-2-yl]methyl]urea?
The canonical SMILES for 1-(1-adamantyl)-3-[[(2S,4S)-4-fluoropyrrolidin-2-yl]methyl]urea is O=C(NC[C@@H]1C[C@H](F)CN1)NC12CC3CC(CC(C3)C1)C2.
What is the InChIKey of 1-(1-adamantyl)-3-[[(2S,4S)-4-fluoropyrrolidin-2-yl]methyl]urea?
The InChIKey is RLTKAZJAMAAWML-FUDOWXGNSA-N. The full InChI is InChI=1S/C16H26FN3O/c17-13-4-14(18-8-13)9-19-15(21)20-16-5-10-1-11(6-16)3-12(2-10)7-16/h10-14,18H,1-9H2,(H2,19,20,21)/t10?,11?,12?,13-,14-,16?/m0/s1.
What are the key properties of 1-(1-adamantyl)-3-[[(2S,4S)-4-fluoropyrrolidin-2-yl]methyl]urea?
1-(1-adamantyl)-3-[[(2S,4S)-4-fluoropyrrolidin-2-yl]methyl]urea has a molecular weight of 295.40 g/mol, XLogP of 1.95, 3 rotatable bonds, 3 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(1-adamantyl)-3-[[(2S,4S)-4-fluoropyrrolidin-2-yl]methyl]urea is sourced from PubChem (CID 70788671), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).