C18H17F2NO3 — CID 70788889
[4-(difluoromethoxy)phenyl]-[3-(2-methylphenoxy)azetidin-1-yl]methanone (PubChem CID 70788889) has the molecular formula C18H17F2NO3 and a molecular weight of 333.33 g/mol. Its IUPAC name is [4-(difluoromethoxy)phenyl]-[3-(2-methylphenoxy)azetidin-1-yl]methanone.
| Compound Name | [4-(difluoromethoxy)phenyl]-[3-(2-methylphenoxy)azetidin-1-yl]methanone |
|---|---|
| PubChem CID | 70788889 |
| Molecular Formula | C18H17F2NO3 |
| Molecular Weight | 333.33 g/mol |
| Exact Mass | 333.12 |
| IUPAC Name | [4-(difluoromethoxy)phenyl]-[3-(2-methylphenoxy)azetidin-1-yl]methanone |
| SMILES | Cc1ccccc1OC1CN(C(=O)c2ccc(OC(F)F)cc2)C1 |
| InChI | InChI=1S/C18H17F2NO3/c1-12-4-2-3-5-16(12)23-15-10-21(11-15)17(22)13-6-8-14(9-7-13)24-18(19)20/h2-9,15,18H,10-11H2,1H3 |
| InChIKey | PMQXTDBSQWOZHY-UHFFFAOYSA-N |
| XLogP | 3.50 |
| TPSA | 38.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.33 |
| LogP ≤ 5 | 3.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |