C15H11FN2O — CID 70789104
6-[2-(3-fluorophenyl)ethynyl]-N-methylpyridine-3-carboxamide (PubChem CID 70789104) has the molecular formula C15H11FN2O and a molecular weight of 254.26 g/mol. Its IUPAC name is 6-[2-(3-fluorophenyl)ethynyl]-N-methylpyridine-3-carboxamide.
| Compound Name | 6-[2-(3-fluorophenyl)ethynyl]-N-methylpyridine-3-carboxamide |
|---|---|
| PubChem CID | 70789104 |
| Molecular Formula | C15H11FN2O |
| Molecular Weight | 254.26 g/mol |
| Exact Mass | 254.09 |
| IUPAC Name | 6-[2-(3-fluorophenyl)ethynyl]-N-methylpyridine-3-carboxamide |
| SMILES | CNC(=O)c1ccc(C#Cc2cccc(F)c2)nc1 |
| InChI | InChI=1S/C15H11FN2O/c1-17-15(19)12-6-8-14(18-10-12)7-5-11-3-2-4-13(16)9-11/h2-4,6,8-10H,1H3,(H,17,19) |
| InChIKey | UGOPFEPBDQXFLZ-UHFFFAOYSA-N |
| XLogP | 1.98 |
| TPSA | 41.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 254.26 |
| LogP ≤ 5 | 1.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|