About (5-ethyl-1,2-oxazol-3-yl)methanamine;hydrochloride
(5-ethyl-1,2-oxazol-3-yl)methanamine;hydrochloride (PubChem CID 70789245) has the molecular formula C6H11ClN2O
and a molecular weight of 162.62 g/mol. Its IUPAC name is (5-ethyl-1,2-oxazol-3-yl)methanamine;hydrochloride.
Molecular Properties
| Compound Name | (5-ethyl-1,2-oxazol-3-yl)methanamine;hydrochloride |
| PubChem CID | 70789245 |
| Molecular Formula | C6H11ClN2O |
| Molecular Weight | 162.62 g/mol |
| Exact Mass | 162.06 |
| IUPAC Name | (5-ethyl-1,2-oxazol-3-yl)methanamine;hydrochloride |
| SMILES | CCc1cc(CN)no1.Cl |
| InChI | InChI=1S/C6H10N2O.ClH/c1-2-6-3-5(4-7)8-9-6;/h3H,2,4,7H2,1H3;1H |
| InChIKey | CKPDODLFNLXDSC-UHFFFAOYSA-N |
| XLogP | 1.12 |
| TPSA | 52.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 162.62 |
| LogP ≤ 5 | 1.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze (5-ethyl-1,2-oxazol-3-yl)methanamine;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (5-ethyl-1,2-oxazol-3-yl)methanamine;hydrochloride?
The IUPAC name of (5-ethyl-1,2-oxazol-3-yl)methanamine;hydrochloride (CID 70789245) is (5-ethyl-1,2-oxazol-3-yl)methanamine;hydrochloride.
What is the SMILES notation for (5-ethyl-1,2-oxazol-3-yl)methanamine;hydrochloride?
The canonical SMILES for (5-ethyl-1,2-oxazol-3-yl)methanamine;hydrochloride is CCc1cc(CN)no1.Cl.
What is the InChIKey of (5-ethyl-1,2-oxazol-3-yl)methanamine;hydrochloride?
The InChIKey is CKPDODLFNLXDSC-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H10N2O.ClH/c1-2-6-3-5(4-7)8-9-6;/h3H,2,4,7H2,1H3;1H.
What are the key properties of (5-ethyl-1,2-oxazol-3-yl)methanamine;hydrochloride?
(5-ethyl-1,2-oxazol-3-yl)methanamine;hydrochloride has a molecular weight of 162.62 g/mol, XLogP of 1.12, 2 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (5-ethyl-1,2-oxazol-3-yl)methanamine;hydrochloride is sourced from PubChem (CID 70789245), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).