About 9-(7H-purin-6-yl)-1,9-diazaspiro[5.5]undecane
9-(7H-purin-6-yl)-1,9-diazaspiro[5.5]undecane (PubChem CID 70789254) has the molecular formula C14H20N6
and a molecular weight of 272.36 g/mol. Its IUPAC name is 9-(7H-purin-6-yl)-1,9-diazaspiro[5.5]undecane.
Molecular Properties
| Compound Name | 9-(7H-purin-6-yl)-1,9-diazaspiro[5.5]undecane |
| PubChem CID | 70789254 |
| Molecular Formula | C14H20N6 |
| Molecular Weight | 272.36 g/mol |
| Exact Mass | 272.17 |
| IUPAC Name | 9-(7H-purin-6-yl)-1,9-diazaspiro[5.5]undecane |
| SMILES | c1nc(N2CCC3(CCCCN3)CC2)c2[nH]cnc2n1 |
| InChI | InChI=1S/C14H20N6/c1-2-6-19-14(3-1)4-7-20(8-5-14)13-11-12(16-9-15-11)17-10-18-13/h9-10,19H,1-8H2,(H,15,16,17,18) |
| InChIKey | SLPPJSSITOXUMX-UHFFFAOYSA-N |
| XLogP | 1.47 |
| TPSA | 69.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 272.36 |
| LogP ≤ 5 | 1.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 9-(7H-purin-6-yl)-1,9-diazaspiro[5.5]undecane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 9-(7H-purin-6-yl)-1,9-diazaspiro[5.5]undecane?
The IUPAC name of 9-(7H-purin-6-yl)-1,9-diazaspiro[5.5]undecane (CID 70789254) is 9-(7H-purin-6-yl)-1,9-diazaspiro[5.5]undecane.
What is the SMILES notation for 9-(7H-purin-6-yl)-1,9-diazaspiro[5.5]undecane?
The canonical SMILES for 9-(7H-purin-6-yl)-1,9-diazaspiro[5.5]undecane is c1nc(N2CCC3(CCCCN3)CC2)c2[nH]cnc2n1.
What is the InChIKey of 9-(7H-purin-6-yl)-1,9-diazaspiro[5.5]undecane?
The InChIKey is SLPPJSSITOXUMX-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H20N6/c1-2-6-19-14(3-1)4-7-20(8-5-14)13-11-12(16-9-15-11)17-10-18-13/h9-10,19H,1-8H2,(H,15,16,17,18).
What are the key properties of 9-(7H-purin-6-yl)-1,9-diazaspiro[5.5]undecane?
9-(7H-purin-6-yl)-1,9-diazaspiro[5.5]undecane has a molecular weight of 272.36 g/mol, XLogP of 1.47, 1 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 9-(7H-purin-6-yl)-1,9-diazaspiro[5.5]undecane is sourced from PubChem (CID 70789254), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).