C27H30F2N4O2 — CID 70789283
N-[(2S,3R)-1-(3,5-difluorophenyl)-3-hydroxy-4-[[(1S)-1-(3-pyrazol-1-ylphenyl)cyclohex-2-en-1-yl]amino]butan-2-yl]acetamide (PubChem CID 70789283) has the molecular formula C27H30F2N4O2 and a molecular weight of 480.56 g/mol. Its IUPAC name is N-[(2S,3R)-1-(3,5-difluorophenyl)-3-hydroxy-4-[[(1S)-1-(3-pyrazol-1-ylphenyl)cyclohex-2-en-1-yl]amino]butan-2-yl]acetamide.
| Compound Name | N-[(2S,3R)-1-(3,5-difluorophenyl)-3-hydroxy-4-[[(1S)-1-(3-pyrazol-1-ylphenyl)cyclohex-2-en-1-yl]amino]butan-2-yl]acetamide |
|---|---|
| PubChem CID | 70789283 |
| Molecular Formula | C27H30F2N4O2 |
| Molecular Weight | 480.56 g/mol |
| Exact Mass | 480.23 |
| IUPAC Name | N-[(2S,3R)-1-(3,5-difluorophenyl)-3-hydroxy-4-[[(1S)-1-(3-pyrazol-1-ylphenyl)cyclohex-2-en-1-yl]amino]butan-2-yl]acetamide |
| SMILES | CC(=O)N[C@@H](Cc1cc(F)cc(F)c1)[C@H](O)CN[C@]1(c2cccc(-n3cccn3)c2)C=CCCC1 |
| InChI | InChI=1S/C27H30F2N4O2/c1-19(34)32-25(15-20-13-22(28)17-23(29)14-20)26(35)18-30-27(9-3-2-4-10-27)21-7-5-8-24(16-21)33-12-6-11-31-33/h3,5-9,11-14,16-17,25-26,30,35H,2,4,10,15,18H2,1H3,(H,32,34)/t25-,26+,27+/m0/s1 |
| InChIKey | MQYZHMBVKWYCIU-OYUWMTPXSA-N |
| XLogP | 3.78 |
| TPSA | 79.18 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 480.56 |
| LogP ≤ 5 | 3.78 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|