C15H17ClF3NO2S — CID 70789290
1-[4-[4-chloro-3-(trifluoromethyl)phenyl]-4-hydroxypiperidin-1-yl]-3-sulfanylpropan-1-one (PubChem CID 70789290) has the molecular formula C15H17ClF3NO2S and a molecular weight of 367.82 g/mol. Its IUPAC name is 1-[4-[4-chloro-3-(trifluoromethyl)phenyl]-4-hydroxypiperidin-1-yl]-3-sulfanylpropan-1-one.
| Compound Name | 1-[4-[4-chloro-3-(trifluoromethyl)phenyl]-4-hydroxypiperidin-1-yl]-3-sulfanylpropan-1-one |
|---|---|
| PubChem CID | 70789290 |
| Molecular Formula | C15H17ClF3NO2S |
| Molecular Weight | 367.82 g/mol |
| Exact Mass | 367.06 |
| IUPAC Name | 1-[4-[4-chloro-3-(trifluoromethyl)phenyl]-4-hydroxypiperidin-1-yl]-3-sulfanylpropan-1-one |
| SMILES | O=C(CCS)N1CCC(O)(c2ccc(Cl)c(C(F)(F)F)c2)CC1 |
| InChI | InChI=1S/C15H17ClF3NO2S/c16-12-2-1-10(9-11(12)15(17,18)19)14(22)4-6-20(7-5-14)13(21)3-8-23/h1-2,9,22-23H,3-8H2 |
| InChIKey | STKPEUISNQZVRV-UHFFFAOYSA-N |
| XLogP | 3.49 |
| TPSA | 40.54 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.82 |
| LogP ≤ 5 | 3.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|