C19H23N3O3S2 — CID 70789381
N-[4-(1,3-thiazol-2-ylsulfamoyl)phenyl]spiro[3.5]nonane-7-carboxamide (PubChem CID 70789381) has the molecular formula C19H23N3O3S2 and a molecular weight of 405.55 g/mol. Its IUPAC name is N-[4-(1,3-thiazol-2-ylsulfamoyl)phenyl]spiro[3.5]nonane-7-carboxamide.
| Compound Name | N-[4-(1,3-thiazol-2-ylsulfamoyl)phenyl]spiro[3.5]nonane-7-carboxamide |
|---|---|
| PubChem CID | 70789381 |
| Molecular Formula | C19H23N3O3S2 |
| Molecular Weight | 405.55 g/mol |
| Exact Mass | 405.12 |
| IUPAC Name | N-[4-(1,3-thiazol-2-ylsulfamoyl)phenyl]spiro[3.5]nonane-7-carboxamide |
| SMILES | O=C(Nc1ccc(S(=O)(=O)Nc2nccs2)cc1)C1CCC2(CCC2)CC1 |
| InChI | InChI=1S/C19H23N3O3S2/c23-17(14-6-10-19(11-7-14)8-1-9-19)21-15-2-4-16(5-3-15)27(24,25)22-18-20-12-13-26-18/h2-5,12-14H,1,6-11H2,(H,20,22)(H,21,23) |
| InChIKey | PPYRWXXKWREOAS-UHFFFAOYSA-N |
| XLogP | 4.24 |
| TPSA | 88.16 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.55 |
| LogP ≤ 5 | 4.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |