About N-(4-phenyl-1,3-thiazol-2-yl)-3-(pyridin-3-ylsulfonylamino)pyridine-4-carboxamide
N-(4-phenyl-1,3-thiazol-2-yl)-3-(pyridin-3-ylsulfonylamino)pyridine-4-carboxamide (PubChem CID 70789450) has the molecular formula C20H15N5O3S2
and a molecular weight of 437.51 g/mol. Its IUPAC name is N-(4-phenyl-1,3-thiazol-2-yl)-3-(pyridin-3-ylsulfonylamino)pyridine-4-carboxamide.
Molecular Properties
| Compound Name | N-(4-phenyl-1,3-thiazol-2-yl)-3-(pyridin-3-ylsulfonylamino)pyridine-4-carboxamide |
| PubChem CID | 70789450 |
| Molecular Formula | C20H15N5O3S2 |
| Molecular Weight | 437.51 g/mol |
| Exact Mass | 437.06 |
| IUPAC Name | N-(4-phenyl-1,3-thiazol-2-yl)-3-(pyridin-3-ylsulfonylamino)pyridine-4-carboxamide |
| SMILES | O=C(Nc1nc(-c2ccccc2)cs1)c1ccncc1NS(=O)(=O)c1cccnc1 |
| InChI | InChI=1S/C20H15N5O3S2/c26-19(24-20-23-18(13-29-20)14-5-2-1-3-6-14)16-8-10-22-12-17(16)25-30(27,28)15-7-4-9-21-11-15/h1-13,25H,(H,23,24,26) |
| InChIKey | PKXGEMWOLLLERF-UHFFFAOYSA-N |
| XLogP | 3.65 |
| TPSA | 113.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 437.51 |
| LogP ≤ 5 | 3.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
Analyze N-(4-phenyl-1,3-thiazol-2-yl)-3-(pyridin-3-ylsulfonylamino)pyridine-4-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(4-phenyl-1,3-thiazol-2-yl)-3-(pyridin-3-ylsulfonylamino)pyridine-4-carboxamide?
The IUPAC name of N-(4-phenyl-1,3-thiazol-2-yl)-3-(pyridin-3-ylsulfonylamino)pyridine-4-carboxamide (CID 70789450) is N-(4-phenyl-1,3-thiazol-2-yl)-3-(pyridin-3-ylsulfonylamino)pyridine-4-carboxamide.
What is the SMILES notation for N-(4-phenyl-1,3-thiazol-2-yl)-3-(pyridin-3-ylsulfonylamino)pyridine-4-carboxamide?
The canonical SMILES for N-(4-phenyl-1,3-thiazol-2-yl)-3-(pyridin-3-ylsulfonylamino)pyridine-4-carboxamide is O=C(Nc1nc(-c2ccccc2)cs1)c1ccncc1NS(=O)(=O)c1cccnc1.
What is the InChIKey of N-(4-phenyl-1,3-thiazol-2-yl)-3-(pyridin-3-ylsulfonylamino)pyridine-4-carboxamide?
The InChIKey is PKXGEMWOLLLERF-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H15N5O3S2/c26-19(24-20-23-18(13-29-20)14-5-2-1-3-6-14)16-8-10-22-12-17(16)25-30(27,28)15-7-4-9-21-11-15/h1-13,25H,(H,23,24,26).
What are the key properties of N-(4-phenyl-1,3-thiazol-2-yl)-3-(pyridin-3-ylsulfonylamino)pyridine-4-carboxamide?
N-(4-phenyl-1,3-thiazol-2-yl)-3-(pyridin-3-ylsulfonylamino)pyridine-4-carboxamide has a molecular weight of 437.51 g/mol, XLogP of 3.65, 6 rotatable bonds, 2 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for N-(4-phenyl-1,3-thiazol-2-yl)-3-(pyridin-3-ylsulfonylamino)pyridine-4-carboxamide is sourced from PubChem (CID 70789450), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).