C27H30N2O3S — CID 70789730
4-benzyl-N-[2-(3,4-diethoxyphenyl)propyl]thieno[3,2-b]pyrrole-5-carboxamide (PubChem CID 70789730) has the molecular formula C27H30N2O3S and a molecular weight of 462.62 g/mol. Its IUPAC name is 4-benzyl-N-[2-(3,4-diethoxyphenyl)propyl]thieno[3,2-b]pyrrole-5-carboxamide.
| Compound Name | 4-benzyl-N-[2-(3,4-diethoxyphenyl)propyl]thieno[3,2-b]pyrrole-5-carboxamide |
|---|---|
| PubChem CID | 70789730 |
| Molecular Formula | C27H30N2O3S |
| Molecular Weight | 462.62 g/mol |
| Exact Mass | 462.20 |
| IUPAC Name | 4-benzyl-N-[2-(3,4-diethoxyphenyl)propyl]thieno[3,2-b]pyrrole-5-carboxamide |
| SMILES | CCOc1ccc(C(C)CNC(=O)c2cc3sccc3n2Cc2ccccc2)cc1OCC |
| InChI | InChI=1S/C27H30N2O3S/c1-4-31-24-12-11-21(15-25(24)32-5-2)19(3)17-28-27(30)23-16-26-22(13-14-33-26)29(23)18-20-9-7-6-8-10-20/h6-16,19H,4-5,17-18H2,1-3H3,(H,28,30) |
| InChIKey | JSIAQJXGRVJVSC-UHFFFAOYSA-N |
| XLogP | 6.08 |
| TPSA | 52.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.62 |
| LogP ≤ 5 | 6.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |