C21H25ClFNO2 — CID 70790014
N-[[3-chloro-5-ethoxy-4-[(3-fluorophenyl)methoxy]phenyl]methyl]cyclopentanamine (PubChem CID 70790014) has the molecular formula C21H25ClFNO2 and a molecular weight of 377.89 g/mol. Its IUPAC name is N-[[3-chloro-5-ethoxy-4-[(3-fluorophenyl)methoxy]phenyl]methyl]cyclopentanamine.
| Compound Name | N-[[3-chloro-5-ethoxy-4-[(3-fluorophenyl)methoxy]phenyl]methyl]cyclopentanamine |
|---|---|
| PubChem CID | 70790014 |
| Molecular Formula | C21H25ClFNO2 |
| Molecular Weight | 377.89 g/mol |
| Exact Mass | 377.16 |
| IUPAC Name | N-[[3-chloro-5-ethoxy-4-[(3-fluorophenyl)methoxy]phenyl]methyl]cyclopentanamine |
| SMILES | CCOc1cc(CNC2CCCC2)cc(Cl)c1OCc1cccc(F)c1 |
| InChI | InChI=1S/C21H25ClFNO2/c1-2-25-20-12-16(13-24-18-8-3-4-9-18)11-19(22)21(20)26-14-15-6-5-7-17(23)10-15/h5-7,10-12,18,24H,2-4,8-9,13-14H2,1H3 |
| InChIKey | XZQXOMURDKFTFA-UHFFFAOYSA-N |
| XLogP | 5.49 |
| TPSA | 30.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.89 |
| LogP ≤ 5 | 5.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |