About 20,20-dimethyl-20-azoniaoctaspiro[3.1.1.1.1.1.1.1.318.116.114.112.110.18.16.14]octacosane
20,20-dimethyl-20-azoniaoctaspiro[3.1.1.1.1.1.1.1.318.116.114.112.110.18.16.14]octacosane (PubChem CID 70790220) has the molecular formula C29H44N+
and a molecular weight of 406.68 g/mol. Its IUPAC name is 20,20-dimethyl-20-azoniaoctaspiro[3.1.1.1.1.1.1.1.318.116.114.112.110.18.16.14]octacosane.
Molecular Properties
| Compound Name | 20,20-dimethyl-20-azoniaoctaspiro[3.1.1.1.1.1.1.1.318.116.114.112.110.18.16.14]octacosane |
| PubChem CID | 70790220 |
| Molecular Formula | C29H44N+ |
| Molecular Weight | 406.68 g/mol |
| Exact Mass | 406.35 |
| IUPAC Name | 20,20-dimethyl-20-azoniaoctaspiro[3.1.1.1.1.1.1.1.318.116.114.112.110.18.16.14]octacosane |
| SMILES | C[N+]1(C)CC2(CC3(CC4(CC5(CC6(CC7(CC8(CC9(CCC9)C8)C7)C6)C5)C4)C3)C2)C1 |
| InChI | InChI=1S/C29H44N/c1-30(2)20-29(21-30)18-28(19-29)16-27(17-28)14-26(15-27)12-25(13-26)10-24(11-25)8-23(9-24)6-22(7-23)4-3-5-22/h3-21H2,1-2H3/q+1 |
| InChIKey | OUOQFKSMEDGPND-UHFFFAOYSA-N |
| XLogP | 6.71 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 30 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 406.68 |
| LogP ≤ 5 | 6.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|
Analyze 20,20-dimethyl-20-azoniaoctaspiro[3.1.1.1.1.1.1.1.318.116.114.112.110.18.16.14]octacosane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 20,20-dimethyl-20-azoniaoctaspiro[3.1.1.1.1.1.1.1.318.116.114.112.110.18.16.14]octacosane?
The IUPAC name of 20,20-dimethyl-20-azoniaoctaspiro[3.1.1.1.1.1.1.1.318.116.114.112.110.18.16.14]octacosane (CID 70790220) is 20,20-dimethyl-20-azoniaoctaspiro[3.1.1.1.1.1.1.1.318.116.114.112.110.18.16.14]octacosane.
What is the SMILES notation for 20,20-dimethyl-20-azoniaoctaspiro[3.1.1.1.1.1.1.1.318.116.114.112.110.18.16.14]octacosane?
The canonical SMILES for 20,20-dimethyl-20-azoniaoctaspiro[3.1.1.1.1.1.1.1.318.116.114.112.110.18.16.14]octacosane is C[N+]1(C)CC2(CC3(CC4(CC5(CC6(CC7(CC8(CC9(CCC9)C8)C7)C6)C5)C4)C3)C2)C1.
What is the InChIKey of 20,20-dimethyl-20-azoniaoctaspiro[3.1.1.1.1.1.1.1.318.116.114.112.110.18.16.14]octacosane?
The InChIKey is OUOQFKSMEDGPND-UHFFFAOYSA-N. The full InChI is InChI=1S/C29H44N/c1-30(2)20-29(21-30)18-28(19-29)16-27(17-28)14-26(15-27)12-25(13-26)10-24(11-25)8-23(9-24)6-22(7-23)4-3-5-22/h3-21H2,1-2H3/q+1.
What are the key properties of 20,20-dimethyl-20-azoniaoctaspiro[3.1.1.1.1.1.1.1.318.116.114.112.110.18.16.14]octacosane?
20,20-dimethyl-20-azoniaoctaspiro[3.1.1.1.1.1.1.1.318.116.114.112.110.18.16.14]octacosane has a molecular weight of 406.68 g/mol, XLogP of 6.71, 0 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 20,20-dimethyl-20-azoniaoctaspiro[3.1.1.1.1.1.1.1.318.116.114.112.110.18.16.14]octacosane is sourced from PubChem (CID 70790220), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).