C30H41N3O5 — CID 70790251
(3R,8S)-8-cyclohexyl-18-methoxy-13,13-dimethyl-2,11-dioxa-6,9,23-triazatetracyclo[15.6.2.13,6.020,24]hexacosa-1(23),17,19,21,24-pentaene-7,10-dione (PubChem CID 70790251) has the molecular formula C30H41N3O5 and a molecular weight of 523.67 g/mol. Its IUPAC name is (3R,8S)-8-cyclohexyl-18-methoxy-13,13-dimethyl-2,11-dioxa-6,9,23-triazatetracyclo[15.6.2.13,6.020,24]hexacosa-1(23),17,19,21,24-pentaene-7,10-dione.
| Compound Name | (3R,8S)-8-cyclohexyl-18-methoxy-13,13-dimethyl-2,11-dioxa-6,9,23-triazatetracyclo[15.6.2.13,6.020,24]hexacosa-1(23),17,19,21,24-pentaene-7,10-dione |
|---|---|
| PubChem CID | 70790251 |
| Molecular Formula | C30H41N3O5 |
| Molecular Weight | 523.67 g/mol |
| Exact Mass | 523.30 |
| IUPAC Name | (3R,8S)-8-cyclohexyl-18-methoxy-13,13-dimethyl-2,11-dioxa-6,9,23-triazatetracyclo[15.6.2.13,6.020,24]hexacosa-1(23),17,19,21,24-pentaene-7,10-dione |
| SMILES | COc1cc2ccnc3c2cc1CCCC(C)(C)COC(=O)N[C@@H](C1CCCCC1)C(=O)N1CC[C@H](C1)O3 |
| InChI | InChI=1S/C30H41N3O5/c1-30(2)13-7-10-22-16-24-21(17-25(22)36-3)11-14-31-27(24)38-23-12-15-33(18-23)28(34)26(32-29(35)37-19-30)20-8-5-4-6-9-20/h11,14,16-17,20,23,26H,4-10,12-13,15,18-19H2,1-3H3,(H,32,35)/t23-,26+/m1/s1 |
| InChIKey | HOIJGOVKQLJDIP-BVAGGSTKSA-N |
| XLogP | 5.26 |
| TPSA | 89.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 523.67 |
| LogP ≤ 5 | 5.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |