About 3,3-dimethyl-9H-benzo[g]indol-9-ide;lawrencium
3,3-dimethyl-9H-benzo[g]indol-9-ide;lawrencium (PubChem CID 70790261) has the molecular formula C14H12LrN-
and a molecular weight of 456.26 g/mol. Its IUPAC name is 3,3-dimethyl-9H-benzo[g]indol-9-ide;lawrencium.
Molecular Properties
| Compound Name | 3,3-dimethyl-9H-benzo[g]indol-9-ide;lawrencium |
| PubChem CID | 70790261 |
| Molecular Formula | C14H12LrN- |
| Molecular Weight | 456.26 g/mol |
| Exact Mass | 456.21 |
| IUPAC Name | 3,3-dimethyl-9H-benzo[g]indol-9-ide;lawrencium |
| SMILES | CC1(C)C=Nc2c1ccc1ccc[c-]c21.[Lr] |
| InChI | InChI=1S/C14H12N.Lr/c1-14(2)9-15-13-11-6-4-3-5-10(11)7-8-12(13)14;/h3-5,7-9H,1-2H3;/q-1; |
| InChIKey | XNPYINMBMBMSDS-UHFFFAOYSA-N |
| XLogP | 3.63 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 456.26 |
| LogP ≤ 5 | 3.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|
Analyze 3,3-dimethyl-9H-benzo[g]indol-9-ide;lawrencium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3,3-dimethyl-9H-benzo[g]indol-9-ide;lawrencium?
The IUPAC name of 3,3-dimethyl-9H-benzo[g]indol-9-ide;lawrencium (CID 70790261) is 3,3-dimethyl-9H-benzo[g]indol-9-ide;lawrencium.
What is the SMILES notation for 3,3-dimethyl-9H-benzo[g]indol-9-ide;lawrencium?
The canonical SMILES for 3,3-dimethyl-9H-benzo[g]indol-9-ide;lawrencium is CC1(C)C=Nc2c1ccc1ccc[c-]c21.[Lr].
What is the InChIKey of 3,3-dimethyl-9H-benzo[g]indol-9-ide;lawrencium?
The InChIKey is XNPYINMBMBMSDS-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H12N.Lr/c1-14(2)9-15-13-11-6-4-3-5-10(11)7-8-12(13)14;/h3-5,7-9H,1-2H3;/q-1;.
What are the key properties of 3,3-dimethyl-9H-benzo[g]indol-9-ide;lawrencium?
3,3-dimethyl-9H-benzo[g]indol-9-ide;lawrencium has a molecular weight of 456.26 g/mol, XLogP of 3.63, 0 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 3,3-dimethyl-9H-benzo[g]indol-9-ide;lawrencium is sourced from PubChem (CID 70790261), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).