C27H30N2O2 — CID 70790414
(1R)-2-methyl-N-[2-oxo-2-[4-(2-tricyclo[9.4.0.03,8]pentadeca-1(15),3,5,7,11,13-hexaenylidene)piperidin-1-yl]ethyl]cyclopropane-1-carboxamide (PubChem CID 70790414) has the molecular formula C27H30N2O2 and a molecular weight of 414.55 g/mol. Its IUPAC name is (1R)-2-methyl-N-[2-oxo-2-[4-(2-tricyclo[9.4.0.03,8]pentadeca-1(15),3,5,7,11,13-hexaenylidene)piperidin-1-yl]ethyl]cyclopropane-1-carboxamide.
| Compound Name | (1R)-2-methyl-N-[2-oxo-2-[4-(2-tricyclo[9.4.0.03,8]pentadeca-1(15),3,5,7,11,13-hexaenylidene)piperidin-1-yl]ethyl]cyclopropane-1-carboxamide |
|---|---|
| PubChem CID | 70790414 |
| Molecular Formula | C27H30N2O2 |
| Molecular Weight | 414.55 g/mol |
| Exact Mass | 414.23 |
| IUPAC Name | (1R)-2-methyl-N-[2-oxo-2-[4-(2-tricyclo[9.4.0.03,8]pentadeca-1(15),3,5,7,11,13-hexaenylidene)piperidin-1-yl]ethyl]cyclopropane-1-carboxamide |
| SMILES | CC1C[C@H]1C(=O)NCC(=O)N1CCC(=C2c3ccccc3CCc3ccccc32)CC1 |
| InChI | InChI=1S/C27H30N2O2/c1-18-16-24(18)27(31)28-17-25(30)29-14-12-21(13-15-29)26-22-8-4-2-6-19(22)10-11-20-7-3-5-9-23(20)26/h2-9,18,24H,10-17H2,1H3,(H,28,31)/t18?,24-/m1/s1 |
| InChIKey | ZWPVJHVLYPJONF-VCUSLETLSA-N |
| XLogP | 3.98 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.55 |
| LogP ≤ 5 | 3.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'styrene_A(13)', 'substructure': 'N/A'} |
|---|