About 6-(2,5-dioxopyrrol-1-yl)-N'-methylhexanehydrazide
6-(2,5-dioxopyrrol-1-yl)-N'-methylhexanehydrazide (PubChem CID 70790417) has the molecular formula C11H17N3O3
and a molecular weight of 239.27 g/mol. Its IUPAC name is 6-(2,5-dioxopyrrol-1-yl)-N'-methylhexanehydrazide.
Molecular Properties
| Compound Name | 6-(2,5-dioxopyrrol-1-yl)-N'-methylhexanehydrazide |
| PubChem CID | 70790417 |
| Molecular Formula | C11H17N3O3 |
| Molecular Weight | 239.27 g/mol |
| Exact Mass | 239.13 |
| IUPAC Name | 6-(2,5-dioxopyrrol-1-yl)-N'-methylhexanehydrazide |
| SMILES | CNNC(=O)CCCCCN1C(=O)C=CC1=O |
| InChI | InChI=1S/C11H17N3O3/c1-12-13-9(15)5-3-2-4-8-14-10(16)6-7-11(14)17/h6-7,12H,2-5,8H2,1H3,(H,13,15) |
| InChIKey | ZEPGPPSEFBGKEF-UHFFFAOYSA-N |
| XLogP | -0.28 |
| TPSA | 78.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 239.27 |
| LogP ≤ 5 | -0.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|
Analyze 6-(2,5-dioxopyrrol-1-yl)-N'-methylhexanehydrazide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-(2,5-dioxopyrrol-1-yl)-N'-methylhexanehydrazide?
The IUPAC name of 6-(2,5-dioxopyrrol-1-yl)-N'-methylhexanehydrazide (CID 70790417) is 6-(2,5-dioxopyrrol-1-yl)-N'-methylhexanehydrazide.
What is the SMILES notation for 6-(2,5-dioxopyrrol-1-yl)-N'-methylhexanehydrazide?
The canonical SMILES for 6-(2,5-dioxopyrrol-1-yl)-N'-methylhexanehydrazide is CNNC(=O)CCCCCN1C(=O)C=CC1=O.
What is the InChIKey of 6-(2,5-dioxopyrrol-1-yl)-N'-methylhexanehydrazide?
The InChIKey is ZEPGPPSEFBGKEF-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H17N3O3/c1-12-13-9(15)5-3-2-4-8-14-10(16)6-7-11(14)17/h6-7,12H,2-5,8H2,1H3,(H,13,15).
What are the key properties of 6-(2,5-dioxopyrrol-1-yl)-N'-methylhexanehydrazide?
6-(2,5-dioxopyrrol-1-yl)-N'-methylhexanehydrazide has a molecular weight of 239.27 g/mol, XLogP of -0.28, 7 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 6-(2,5-dioxopyrrol-1-yl)-N'-methylhexanehydrazide is sourced from PubChem (CID 70790417), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).